摘要
The title complex chloro(p-toluidine)[4-(p-tolyl)imino-2-pentanone-3-oximato]- palladium(Ⅱ), PdCl(p-CH3C6H4NH2)(p-CH3C6H4-iai), C19H22ClN3O2Pd, (p-CH3C6H4NH2 and p-CH3C6H4-iai- are p-toluidine and the anion of 4-(p-tolyl)imino-2-pentanone-3-oximato, respec- tively), crystallizes in the monoclinic system, space group C2/c with a = 26.082(5), b = 13.521(3), c = 12.578(3) ? b = 112.18(3), Mr = 466.25, V = 4108(2) 3, Dc = 1.508 g/cm3, F(000) = 1888, m(MoKa) = 1.051 mm-1, Z = 8, the final R = 0.0368 and wR = 0.0855 for 3243 observed reflections (I ≥ 2s(I)). The coordination environment around Pd is a distorted PdClN3 square-plane composed of imino- and oximo-nitrogen from the Schiff base ligand of p-CH3C6H4-iai-, and amino-nitrogen from p-toluidine and chlorine atom.
The title complex chloro(p-toluidine)[4-(p-tolyl)imino-2-pentanone-3-oximato]- palladium(Ⅱ), PdCl(p-CH3C6H4NH2)(p-CH3C6H4-iai), C19H22ClN3O2Pd, (p-CH3C6H4NH2 and p-CH3C6H4-iai- are p-toluidine and the anion of 4-(p-tolyl)imino-2-pentanone-3-oximato, respec- tively), crystallizes in the monoclinic system, space group C2/c with a = 26.082(5), b = 13.521(3), c = 12.578(3) ? b = 112.18(3), Mr = 466.25, V = 4108(2) 3, Dc = 1.508 g/cm3, F(000) = 1888, m(MoKa) = 1.051 mm-1, Z = 8, the final R = 0.0368 and wR = 0.0855 for 3243 observed reflections (I ≥ 2s(I)). The coordination environment around Pd is a distorted PdClN3 square-plane composed of imino- and oximo-nitrogen from the Schiff base ligand of p-CH3C6H4-iai-, and amino-nitrogen from p-toluidine and chlorine atom.
基金
Supported by the Natural Science Foundation of Fujian province (No. E0110010)
