A novel 1,2-diaminocyclohexane（1,2-DACH） decorated manganese thiostannate,namely MnSnS_3（1,2-DACH）（1）,has been solvothermally synthesized by the reaction of Mn（CH_3COO）_2·4H_2O,Sn and S in the stoichiomet...A novel 1,2-diaminocyclohexane（1,2-DACH） decorated manganese thiostannate,namely MnSnS_3（1,2-DACH）（1）,has been solvothermally synthesized by the reaction of Mn（CH_3COO）_2·4H_2O,Sn and S in the stoichiometric ratio in 1,2-DACH,which acted as an efficient structure-directing agent（SDA） and reactive solvent in the formation of the title compound. Single-crystal X-ray diffraction studies revealed that the title compound crystallizes in the monoclinic space group P2_1/c with a = 12.2458（7）,b = 13.8588（7）,c = 7.2292（4） ？,β = 99.460（6）°,V = 1210.20（12） ？~3,Z = 4,Dc = 2.108 g·cm^（-3）,F（000） = 748,μ = 3.584 mm^（-1）,R = 0.0348 and wR = 0.0823（I 〉 2σ（I））. The structure features a neutral two-dimensional（2D） network constructed by the unsaturated [Mn（1,2-DACH）] complexes interconnecting [SnS_3]_n^（2n-） chains via sharing S. Thermal stability and optical property of compound 1 were characterized.展开更多
基金Financial support from the NNSFC(No.21373223)Chunmiao project of Haixi Institute of Chinese Academy of Sciences(CMZX-2014-001)
文摘A novel 1,2-diaminocyclohexane（1,2-DACH） decorated manganese thiostannate,namely MnSnS_3（1,2-DACH）（1）,has been solvothermally synthesized by the reaction of Mn（CH_3COO）_2·4H_2O,Sn and S in the stoichiometric ratio in 1,2-DACH,which acted as an efficient structure-directing agent（SDA） and reactive solvent in the formation of the title compound. Single-crystal X-ray diffraction studies revealed that the title compound crystallizes in the monoclinic space group P2_1/c with a = 12.2458（7）,b = 13.8588（7）,c = 7.2292（4） ？,β = 99.460（6）°,V = 1210.20（12） ？~3,Z = 4,Dc = 2.108 g·cm^（-3）,F（000） = 748,μ = 3.584 mm^（-1）,R = 0.0348 and wR = 0.0823（I 〉 2σ（I））. The structure features a neutral two-dimensional（2D） network constructed by the unsaturated [Mn（1,2-DACH）] complexes interconnecting [SnS_3]_n^（2n-） chains via sharing S. Thermal stability and optical property of compound 1 were characterized.
