A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space gr...A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space group Pi with a = 9.2534(6), b = 13.3131(2), c = 16.0373(2) A, α = 65.981(6), β = 89.792(3), γ = 89.677(4)°, Mr= 880.2, Z = 2, V= 1804.6(3) A3, μ = 1.254 mm-1, F(000) = 932, R = 0.0555 (1 〉 2σ(I)) and wR = 0.1908 for 19343 observed reflections. HMTA substitutes for water molecules are located at the para-positions, forming a stretching octahedral nickel ion unit. Thermo-gravimetric analysis shows that the dehydration temperature of NSH-HMTA is about 92℃. The characteristic UV peaks are approximately 10 nm red-shifted by the absorption of octahedral HMTA complex ion units.展开更多
基金Supported by Key Laboratory of Optoelectronic Materials Chemistry and Physics,Chinese Academy of Sciences
文摘A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space group Pi with a = 9.2534(6), b = 13.3131(2), c = 16.0373(2) A, α = 65.981(6), β = 89.792(3), γ = 89.677(4)°, Mr= 880.2, Z = 2, V= 1804.6(3) A3, μ = 1.254 mm-1, F(000) = 932, R = 0.0555 (1 〉 2σ(I)) and wR = 0.1908 for 19343 observed reflections. HMTA substitutes for water molecules are located at the para-positions, forming a stretching octahedral nickel ion unit. Thermo-gravimetric analysis shows that the dehydration temperature of NSH-HMTA is about 92℃. The characteristic UV peaks are approximately 10 nm red-shifted by the absorption of octahedral HMTA complex ion units.