Co-crystallization of pztcH_4 with 4,4＇-bipyridine（4,4＇-bipy） in pH = 3-4 and 1-2 gave two new binary molecular adducts： [（4,4＇-bipy H2）（pztc H2）]（1） and [（4,4＇-bipy H2）（pztcH3）（Cl）]·4H2O（2）,...Co-crystallization of pztcH_4 with 4,4＇-bipyridine（4,4＇-bipy） in pH = 3-4 and 1-2 gave two new binary molecular adducts： [（4,4＇-bipy H2）（pztc H2）]（1） and [（4,4＇-bipy H2）（pztcH3）（Cl）]·4H2O（2）, respectively. Compounds 1 and 2 have been characterized by IR, elemental analysis, NMR and X-ray single-crystal diffraction. Compound 1 crystallizes in triclinic, space group P1 with a = 5.7752（12）, b = 7.9126（16）, c = 9.4492（19） ？, α = 97.49（3）, β = 107.71（3）, γ = 94.52（3）o, V = 404.62（14） A^3, Z = 1, μ = 0.137 mm^1, Dc = 1.692 Mg/m^3, C18H12N4O8, Mr = 412.32, F（000） = 212, S = 1.025, R = 0.0360 and wR = 0.0973. Compound 2 crystallizes in monoclinic, space group C2/c with a = 17.093（3）, b = 7.7665（16）, c = 18.414（4） A, β = 113.36（3）o, V = 2244.1（8） A^3, Z = 4, μ = 0.244 mm^-1, Dc = 1.542 Mg/m^3, C18H21ClN4O12, Mr = 520.84, F（000） = 1080, S = 1.021, R = 0.0343 and wR = 0.0978. In compound 1, pztc H22- anions self-formed 2-D sheets by strong Oacid-H···Oacidhydrogen bonds, which are further extended to form a 3-D supramolecular network bridged with 4,4？-bipy via N-H···Oacid interactions. In compound 2, besides the 1-D chain constructed by pztc H3-itself through strong H-bond Oacid-H···Oacid, the other chain is constructed with 4,4？-bipy H22＋, Cl-anion and water molecules by moderate H-bonds and Ow-H···Cl and N-H···Ow. The two chains are linked with μ3-connected water molecules resulting from the combination of strong synthon-assisted H-bonding Oacid-H···Ow to afford an interlaced 3-D network.展开更多
8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O （1） was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent meas...8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O （1） was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent measurements. Compound 1 crystallizes in orthorhombic, space group Pbcn with a = 9.953（3）, b = 15.966（3）, c = 16.081（5） A, V = 2555.5（13） A3, Z = 4, μ = 0.122 mm^-1, Dc = 1.514 Mg/m3, T= 296（2） K, C26H22N4O12, Mr = 582.48, F（000） = 1208, S = 1.006, R = 0.0448 and wR = 0.1149. Compound 1 has a three-dimensional （3D） network, in which pyra- zine-2,3,5,6-tetracarboxylic acids build up two-dimensional （2D） sheets and 8-hydroxyquinoline cations and water molecules act as pillars to connect the 2D sheets into an extended 3D network through strong intermolecular hydrogen bonding and π…π stacking interactions. Especially, a very short O-H…O hydrogen bond （O…O 2.470（2） A） between two neighboring [H2pztc] anions was observed.展开更多
In this paper a new cadmium(Ⅱ) complex,[Cd(H2PTA)(H2O)3].3H2O,has been synthesized and characterized by elemental analysis,IR,and X-ray diffraction single crystal structure ananlysis. It belongs to triclinic system,w...In this paper a new cadmium(Ⅱ) complex,[Cd(H2PTA)(H2O)3].3H2O,has been synthesized and characterized by elemental analysis,IR,and X-ray diffraction single crystal structure ananlysis. It belongs to triclinic system,with space group P1,a=0.947 84(19) nm,b=0.990 8(2) nm,c=0.994 3(2) nm,α=114.06(3)°,β=98.56(3)°,γ=111.29(3)°,V=0.744 5(3) nm3,Z=2. This complex is a binuclear unit,and then the binuclear molecules are alternatively assembled into 3D supramolecular network by hydrogen-bond in which there exists a (H2O)4 water cluster. CCDC:724104.展开更多
The complex [Tm（TBTA）1.5（bipy）（H2O）2]n （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, bipy = 2,2-bipyridyl） has been synthesized in water-methanol solution at ambient temperature and characterized by single-cr...The complex [Tm（TBTA）1.5（bipy）（H2O）2]n （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, bipy = 2,2-bipyridyl） has been synthesized in water-methanol solution at ambient temperature and characterized by single-crystal X-ray diffraction, elemental analysis, IR spectrum and thermogravimetric analysis. The crystal belongs to triclinic, space group P1 with a = 11.1429（2）, b = 11.485（2）, c = 12.872（2）, V = 1498.1（5）3 , Z = 2, C22H14Br6N2O9Tm, Mr = 1098.74, Dc = 2.436 g/cm3 , μ（MoKα） = 11.013 mm-1 , F（000） = 1022, T = 296.15 K, the final R （I 〉2σ（I）） = 0.0494 and wR （all data） = 0.1246. The asymmetric unit of the complex is composed of one Tm ion, one and a half of coordinated TBTA 2-anions, one bipy, two coordinated and one lattice water molecules. The adjacent metal ions are bridged by TBTA 2- anions to form a 2D wave-like layer.展开更多
Two 2D layer complexes {[La（TBTA）1.5（phen）2H2O].3H2O}n （1） and {[Ce（TBTA）l.5（phen）2H2O]-3H2O}n （2） （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, phen = 1.10-phenanthroline） have been synthesized and cha...Two 2D layer complexes {[La（TBTA）1.5（phen）2H2O].3H2O}n （1） and {[Ce（TBTA）l.5（phen）2H2O]-3H2O}n （2） （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, phen = 1.10-phenanthroline） have been synthesized and characterized by single-crystal X-ray diffraction, elemental analyses, IR spectra and thermogravimetric analyses. Both crystals belong to monoclinic, space group P21/n. Crystal data for 1： a = 8.7097（11）, b = 34.276（4）, c = 13.7281（17） A, β = 95.397（2）°, V= 4080.1（9） A3, Z = 4, LaC36H24Br6N4O10, Mr= 1290.96, Dc = 2.102 g/cm3,μ（MoKa） = 6.983 mm-1, F（000） = 2460.0, T = 296（2） K, the final R （I 〉 2σ（I）） = 0.0478 and wR （all data） = 0.0985 for 10127 independent （Rint = 0.0775） and 7137 observed reflections with I 〉 2σ（I）. Crystal data for 2： a = 8.709（2）, b = 34.202（9）, c = 13.685（4） A, β = 95.714（4）, V= 4055.9（19） A3, Z = 4, CeBr6C36H24O10N4, Mr = 1292.17, Dc = 2.116 g/cm3, μ（MoKa） = 7.094 mm-1, F（000） = 2464.0, T= 296（2） K, the final R（I 〉 2σ（I）） = 0.0590 and wR（all data） = 0.1453 for 10014 independent （Rint = 0.1253） and 6081 observed reflections with I 〉 2σ（I）. Both complexes are allomerism with the general molecular formula of {[M（TBTA）1.5（phen）2H2O].3H2O}n. In the structures, the H2TBTA ligands adopt a monodentate coordination mode. Both the 2D layer frameworks are further extended to be 3D layers via H-bonding interactions.展开更多
The title complexes [M（ImH）4（tfbdc）（H2O）] （1： M = Co; 2： M = Ni） （ImH = imidazole, tfbdc = 2,3,5,6-tetrafluoroterephthalate） were synthesized by the reaction of M（OAc）2·4H2O, H2ffbdc and ImH in wate...The title complexes [M（ImH）4（tfbdc）（H2O）] （1： M = Co; 2： M = Ni） （ImH = imidazole, tfbdc = 2,3,5,6-tetrafluoroterephthalate） were synthesized by the reaction of M（OAc）2·4H2O, H2ffbdc and ImH in water solution. The complexes were characterized by elemental analysis, IR spectra, thermogravimetric analysis, cyclic voltammetry and X-ray single crystal structure analysis. Structural analysis reveals that 1 and 2 possess isostructure： monoclinic, P2 1/c, Z=4. M（II） ion in complexes 1 and 2 has a distorted octahedral geometry coordinated by one oxygen atom from water, one oxygen atom from tfbdc2- and four nitrogen atoms from ImHs. They are discrete zero-dimensional molecular complexes. And the adjacent monomeric components are connected by hydrogen bonds to form a supramolecule. Electrochemical properties of the complexes 1 and 2 show that electron transfer of M（II） between M（III） in electrolysis is a quasi-reversible process.展开更多
基金supported by the National Natural Science Foundation of China(No.21571094)
文摘Co-crystallization of pztcH_4 with 4,4＇-bipyridine（4,4＇-bipy） in pH = 3-4 and 1-2 gave two new binary molecular adducts： [（4,4＇-bipy H2）（pztc H2）]（1） and [（4,4＇-bipy H2）（pztcH3）（Cl）]·4H2O（2）, respectively. Compounds 1 and 2 have been characterized by IR, elemental analysis, NMR and X-ray single-crystal diffraction. Compound 1 crystallizes in triclinic, space group P1 with a = 5.7752（12）, b = 7.9126（16）, c = 9.4492（19） ？, α = 97.49（3）, β = 107.71（3）, γ = 94.52（3）o, V = 404.62（14） A^3, Z = 1, μ = 0.137 mm^1, Dc = 1.692 Mg/m^3, C18H12N4O8, Mr = 412.32, F（000） = 212, S = 1.025, R = 0.0360 and wR = 0.0973. Compound 2 crystallizes in monoclinic, space group C2/c with a = 17.093（3）, b = 7.7665（16）, c = 18.414（4） A, β = 113.36（3）o, V = 2244.1（8） A^3, Z = 4, μ = 0.244 mm^-1, Dc = 1.542 Mg/m^3, C18H21ClN4O12, Mr = 520.84, F（000） = 1080, S = 1.021, R = 0.0343 and wR = 0.0978. In compound 1, pztc H22- anions self-formed 2-D sheets by strong Oacid-H···Oacidhydrogen bonds, which are further extended to form a 3-D supramolecular network bridged with 4,4？-bipy via N-H···Oacid interactions. In compound 2, besides the 1-D chain constructed by pztc H3-itself through strong H-bond Oacid-H···Oacid, the other chain is constructed with 4,4？-bipy H22＋, Cl-anion and water molecules by moderate H-bonds and Ow-H···Cl and N-H···Ow. The two chains are linked with μ3-connected water molecules resulting from the combination of strong synthon-assisted H-bonding Oacid-H···Ow to afford an interlaced 3-D network.
基金supported by the National Natural Science Foundation of China(No.21162015)Science Foundation of State Key Laboratory of Structural Chemistry(No.20100009)
文摘8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O （1） was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent measurements. Compound 1 crystallizes in orthorhombic, space group Pbcn with a = 9.953（3）, b = 15.966（3）, c = 16.081（5） A, V = 2555.5（13） A3, Z = 4, μ = 0.122 mm^-1, Dc = 1.514 Mg/m3, T= 296（2） K, C26H22N4O12, Mr = 582.48, F（000） = 1208, S = 1.006, R = 0.0448 and wR = 0.1149. Compound 1 has a three-dimensional （3D） network, in which pyra- zine-2,3,5,6-tetracarboxylic acids build up two-dimensional （2D） sheets and 8-hydroxyquinoline cations and water molecules act as pillars to connect the 2D sheets into an extended 3D network through strong intermolecular hydrogen bonding and π…π stacking interactions. Especially, a very short O-H…O hydrogen bond （O…O 2.470（2） A） between two neighboring [H2pztc] anions was observed.
文摘In this paper a new cadmium(Ⅱ) complex,[Cd(H2PTA)(H2O)3].3H2O,has been synthesized and characterized by elemental analysis,IR,and X-ray diffraction single crystal structure ananlysis. It belongs to triclinic system,with space group P1,a=0.947 84(19) nm,b=0.990 8(2) nm,c=0.994 3(2) nm,α=114.06(3)°,β=98.56(3)°,γ=111.29(3)°,V=0.744 5(3) nm3,Z=2. This complex is a binuclear unit,and then the binuclear molecules are alternatively assembled into 3D supramolecular network by hydrogen-bond in which there exists a (H2O)4 water cluster. CCDC:724104.
基金Supported by the International Scientific and Technological Cooperation Projects of Shanxi Province (2011081022)International S&T Cooperation Program of China (2011DFA51980)
文摘The complex [Tm（TBTA）1.5（bipy）（H2O）2]n （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, bipy = 2,2-bipyridyl） has been synthesized in water-methanol solution at ambient temperature and characterized by single-crystal X-ray diffraction, elemental analysis, IR spectrum and thermogravimetric analysis. The crystal belongs to triclinic, space group P1 with a = 11.1429（2）, b = 11.485（2）, c = 12.872（2）, V = 1498.1（5）3 , Z = 2, C22H14Br6N2O9Tm, Mr = 1098.74, Dc = 2.436 g/cm3 , μ（MoKα） = 11.013 mm-1 , F（000） = 1022, T = 296.15 K, the final R （I 〉2σ（I）） = 0.0494 and wR （all data） = 0.1246. The asymmetric unit of the complex is composed of one Tm ion, one and a half of coordinated TBTA 2-anions, one bipy, two coordinated and one lattice water molecules. The adjacent metal ions are bridged by TBTA 2- anions to form a 2D wave-like layer.
基金Supported by the International Scientific and Technological Cooperation Projects of Shanxi Province (2011081022)International S&T Cooperation Program of China (No. 2011DFA51980)the Natural Science Foundation of Shanxi Province (No. 2009021024)
文摘Two 2D layer complexes {[La（TBTA）1.5（phen）2H2O].3H2O}n （1） and {[Ce（TBTA）l.5（phen）2H2O]-3H2O}n （2） （H2TBTA = 2,3,5,6-tetrabromoterephthalic acid, phen = 1.10-phenanthroline） have been synthesized and characterized by single-crystal X-ray diffraction, elemental analyses, IR spectra and thermogravimetric analyses. Both crystals belong to monoclinic, space group P21/n. Crystal data for 1： a = 8.7097（11）, b = 34.276（4）, c = 13.7281（17） A, β = 95.397（2）°, V= 4080.1（9） A3, Z = 4, LaC36H24Br6N4O10, Mr= 1290.96, Dc = 2.102 g/cm3,μ（MoKa） = 6.983 mm-1, F（000） = 2460.0, T = 296（2） K, the final R （I 〉 2σ（I）） = 0.0478 and wR （all data） = 0.0985 for 10127 independent （Rint = 0.0775） and 7137 observed reflections with I 〉 2σ（I）. Crystal data for 2： a = 8.709（2）, b = 34.202（9）, c = 13.685（4） A, β = 95.714（4）, V= 4055.9（19） A3, Z = 4, CeBr6C36H24O10N4, Mr = 1292.17, Dc = 2.116 g/cm3, μ（MoKa） = 7.094 mm-1, F（000） = 2464.0, T= 296（2） K, the final R（I 〉 2σ（I）） = 0.0590 and wR（all data） = 0.1453 for 10014 independent （Rint = 0.1253） and 6081 observed reflections with I 〉 2σ（I）. Both complexes are allomerism with the general molecular formula of {[M（TBTA）1.5（phen）2H2O].3H2O}n. In the structures, the H2TBTA ligands adopt a monodentate coordination mode. Both the 2D layer frameworks are further extended to be 3D layers via H-bonding interactions.
基金Acknowledgement This work was supported by the National Natural Science Foundation of China （Nos. 20671045, 20971060, 21101018） and the Natural Science Foundation of State Key Laboratory of Coordination Chemistry.
文摘The title complexes [M（ImH）4（tfbdc）（H2O）] （1： M = Co; 2： M = Ni） （ImH = imidazole, tfbdc = 2,3,5,6-tetrafluoroterephthalate） were synthesized by the reaction of M（OAc）2·4H2O, H2ffbdc and ImH in water solution. The complexes were characterized by elemental analysis, IR spectra, thermogravimetric analysis, cyclic voltammetry and X-ray single crystal structure analysis. Structural analysis reveals that 1 and 2 possess isostructure： monoclinic, P2 1/c, Z=4. M（II） ion in complexes 1 and 2 has a distorted octahedral geometry coordinated by one oxygen atom from water, one oxygen atom from tfbdc2- and four nitrogen atoms from ImHs. They are discrete zero-dimensional molecular complexes. And the adjacent monomeric components are connected by hydrogen bonds to form a supramolecule. Electrochemical properties of the complexes 1 and 2 show that electron transfer of M（II） between M（III） in electrolysis is a quasi-reversible process.
