A new complex,Co(0.5)Ni(0.5)(C2H6N2O)6SO4(Ⅰ), was synthesized and its single crystal was obtained from aqueous solution by evaporating solvent slowly. Single-crystal X-ray analysis revealed that the complex b...A new complex,Co(0.5)Ni(0.5)(C2H6N2O)6SO4(Ⅰ), was synthesized and its single crystal was obtained from aqueous solution by evaporating solvent slowly. Single-crystal X-ray analysis revealed that the complex belongs to trigonal system, space group R-3c, with a = b = 10.999(2) A, c = 40.439(13) A, V = 4237(2)A3, Z = 6, Dc = 1.410 g/cm3, Mr = 599.41, μ = 0.785 mm-1, F(000) = 1893, the final R = 0.0330 and wR = 0.0926(I 〉 2σ(I)). IR spectrum and compositional analyses(elemental analyzer and ICP) were used to characterize the composition of the product. TGA(Thermal Gravimetric Analysis) showed that complex Ⅰ remained stable until it is heated up to 200 ℃, indicating its good thermostability. The main transmission peak of complex Ⅰ in UV-Vis spectrum appeared at 290 nm, making it an eligible material for ultraviolet light filters(ULF).展开更多
A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space gr...A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space group Pi with a = 9.2534(6), b = 13.3131(2), c = 16.0373(2) A, α = 65.981(6), β = 89.792(3), γ = 89.677(4)°, Mr= 880.2, Z = 2, V= 1804.6(3) A3, μ = 1.254 mm-1, F(000) = 932, R = 0.0555 (1 〉 2σ(I)) and wR = 0.1908 for 19343 observed reflections. HMTA substitutes for water molecules are located at the para-positions, forming a stretching octahedral nickel ion unit. Thermo-gravimetric analysis shows that the dehydration temperature of NSH-HMTA is about 92℃. The characteristic UV peaks are approximately 10 nm red-shifted by the absorption of octahedral HMTA complex ion units.展开更多
基金Supported by Key Laboratory of Optoelectronic Materials Chemistry and Physics,Chinese Academy of Sciences
文摘A new complex,Co(0.5)Ni(0.5)(C2H6N2O)6SO4(Ⅰ), was synthesized and its single crystal was obtained from aqueous solution by evaporating solvent slowly. Single-crystal X-ray analysis revealed that the complex belongs to trigonal system, space group R-3c, with a = b = 10.999(2) A, c = 40.439(13) A, V = 4237(2)A3, Z = 6, Dc = 1.410 g/cm3, Mr = 599.41, μ = 0.785 mm-1, F(000) = 1893, the final R = 0.0330 and wR = 0.0926(I 〉 2σ(I)). IR spectrum and compositional analyses(elemental analyzer and ICP) were used to characterize the composition of the product. TGA(Thermal Gravimetric Analysis) showed that complex Ⅰ remained stable until it is heated up to 200 ℃, indicating its good thermostability. The main transmission peak of complex Ⅰ in UV-Vis spectrum appeared at 290 nm, making it an eligible material for ultraviolet light filters(ULF).
基金Supported by Key Laboratory of Optoelectronic Materials Chemistry and Physics,Chinese Academy of Sciences
文摘A new coordination compound, Ni(C6H12N4)2SO4.4H20(NSH-HMTA) (HMTA, hexamethylenetetramine, C6H12N4), has been synthesized and its single crystals were obtained. NSH-HMTA belongs to the triclinic system, space group Pi with a = 9.2534(6), b = 13.3131(2), c = 16.0373(2) A, α = 65.981(6), β = 89.792(3), γ = 89.677(4)°, Mr= 880.2, Z = 2, V= 1804.6(3) A3, μ = 1.254 mm-1, F(000) = 932, R = 0.0555 (1 〉 2σ(I)) and wR = 0.1908 for 19343 observed reflections. HMTA substitutes for water molecules are located at the para-positions, forming a stretching octahedral nickel ion unit. Thermo-gravimetric analysis shows that the dehydration temperature of NSH-HMTA is about 92℃. The characteristic UV peaks are approximately 10 nm red-shifted by the absorption of octahedral HMTA complex ion units.