A unique metal-organic framework（MOF） [Eu_2（L）_3（phen）_2]_n（1, H_2L = 4,6-dibenzoylisophthalic acid, phen = 1,10-phenanthroline） has been synthesized under hydrothermal conditions and characterized by single-c...A unique metal-organic framework（MOF） [Eu_2（L）_3（phen）_2]_n（1, H_2L = 4,6-dibenzoylisophthalic acid, phen = 1,10-phenanthroline） has been synthesized under hydrothermal conditions and characterized by single-crystal X-ray analysis, elemental analyses, powder X-ray diffraction, TGA measurement as well as IR spectra. The crystal is of triclinic system, space group P1, C_（90）H_（52）Eu_2N_4O_（18）, M_r = 1781.32, a = 9.8697（4）, b = 16.7466（6）, c = 22.2556（10） A, α = 87.113（3）, β = 77.575（5）, γ = 89.458（3）°, V = 3587.8（3） A^3, Z = 2, D_c = 1.649 g/cm^3, F（000） = 1780, μ（MoKα） = 1.813 mm^（-1）, Rint = 0.0181, R = 0.0260 and wR = 0.0592 for 14000 observed reflections with I 〉 2σ（I）. X-ray analysis shows that the title compound exhibits a 2D layer structure linked by L ligands with two coordination modes and two distinguished conformations, and further linked into a 3D supramolecular architecture through C-H···O weak interactions between hydrogen of phen phenyl ring and the carboxylate oxygen atom of adjacent sheets. In addition, the luminescence property of 1 was investigated.展开更多
Two distinct copper coordination polymers, namely [Cu^Ⅱ2（2,5-pydc）2（bpp）2]·H2O（1） and Cu2^ⅠCu^Ⅱ（2,5-pydc）2（bpp）2（2）（2,5-pydc = pyridine-2,5-dicarboxylic acid, bpp = 1,3-bi（4-pyridyl）propane）, h...Two distinct copper coordination polymers, namely [Cu^Ⅱ2（2,5-pydc）2（bpp）2]·H2O（1） and Cu2^ⅠCu^Ⅱ（2,5-pydc）2（bpp）2（2）（2,5-pydc = pyridine-2,5-dicarboxylic acid, bpp = 1,3-bi（4-pyridyl）propane）, have been successfully synthesized through hydrothermal conditions under different temperatures. Single-crystal X-ray structural analysis revealed that both complexes 1 and 2 are 3D frameworks. Complex 1 is an 8-connected 2-fold interpenetrating network based on [Cu（2,5-pydc）]4 molecular building block（MBB）, and also can be simplified as a 4-connected net if the Cu（Ⅱ） ion is regarded as an independent node, whereas 2 shows a（4,4）-connected non-interpenetrated framework which contains mixed valence Cu（Ⅰ/Ⅱ） centers. The results demonstrate that temperature plays a significant role in the final structures of the complexes.展开更多
A metal-organic coordination polymer, [Cd（C15H10N4）（C6H8O4）]2n （1, C15H10N4： 2-methyl-pyrazino-[2,3-f][1,10]-phenanthroline （mpphen）, C6H8O4： adipate）, was synthesized via hydrothermal synthesis. The polymer...A metal-organic coordination polymer, [Cd（C15H10N4）（C6H8O4）]2n （1, C15H10N4： 2-methyl-pyrazino-[2,3-f][1,10]-phenanthroline （mpphen）, C6H8O4： adipate）, was synthesized via hydrothermal synthesis. The polymer was characterized by elemental analysis, IR, TG and single-crystal X-ray diffraction. X-ray diffraction shows that 1 is a cadmium polymer constructed by adipate-bridged dmuclear clusters, and each adipate connects two clusters to form a two-dimen- sional planar structure. Crystal data for 1： monoclinic, space group C2/c, a = 22.403（9）, b = 16.039（6）, c = 13.808（6） A, β= 125.262（6）°, V = 4051（3） A3, Mr = 502.79, Dc = 1.649 g/eraa, μ（MoKa） = 1.114 mm^-1, F（000） = 2016, Z = 8, the final R = 0.0509 and wR = 0.1054 for 1509 observed reflections （I 〉 2σ（I））.展开更多
基金supported by the NNSFC(No.21301170)Xiaonei Foundation of Changchun University of Technology
文摘A unique metal-organic framework（MOF） [Eu_2（L）_3（phen）_2]_n（1, H_2L = 4,6-dibenzoylisophthalic acid, phen = 1,10-phenanthroline） has been synthesized under hydrothermal conditions and characterized by single-crystal X-ray analysis, elemental analyses, powder X-ray diffraction, TGA measurement as well as IR spectra. The crystal is of triclinic system, space group P1, C_（90）H_（52）Eu_2N_4O_（18）, M_r = 1781.32, a = 9.8697（4）, b = 16.7466（6）, c = 22.2556（10） A, α = 87.113（3）, β = 77.575（5）, γ = 89.458（3）°, V = 3587.8（3） A^3, Z = 2, D_c = 1.649 g/cm^3, F（000） = 1780, μ（MoKα） = 1.813 mm^（-1）, Rint = 0.0181, R = 0.0260 and wR = 0.0592 for 14000 observed reflections with I 〉 2σ（I）. X-ray analysis shows that the title compound exhibits a 2D layer structure linked by L ligands with two coordination modes and two distinguished conformations, and further linked into a 3D supramolecular architecture through C-H···O weak interactions between hydrogen of phen phenyl ring and the carboxylate oxygen atom of adjacent sheets. In addition, the luminescence property of 1 was investigated.
基金supported by the application basis research key project of Yunnan Province science and technology department(201401CB00299)the major project of Qujing Normal University(2012ZD002)
文摘Two distinct copper coordination polymers, namely [Cu^Ⅱ2（2,5-pydc）2（bpp）2]·H2O（1） and Cu2^ⅠCu^Ⅱ（2,5-pydc）2（bpp）2（2）（2,5-pydc = pyridine-2,5-dicarboxylic acid, bpp = 1,3-bi（4-pyridyl）propane）, have been successfully synthesized through hydrothermal conditions under different temperatures. Single-crystal X-ray structural analysis revealed that both complexes 1 and 2 are 3D frameworks. Complex 1 is an 8-connected 2-fold interpenetrating network based on [Cu（2,5-pydc）]4 molecular building block（MBB）, and also can be simplified as a 4-connected net if the Cu（Ⅱ） ion is regarded as an independent node, whereas 2 shows a（4,4）-connected non-interpenetrated framework which contains mixed valence Cu（Ⅰ/Ⅱ） centers. The results demonstrate that temperature plays a significant role in the final structures of the complexes.
文摘A metal-organic coordination polymer, [Cd（C15H10N4）（C6H8O4）]2n （1, C15H10N4： 2-methyl-pyrazino-[2,3-f][1,10]-phenanthroline （mpphen）, C6H8O4： adipate）, was synthesized via hydrothermal synthesis. The polymer was characterized by elemental analysis, IR, TG and single-crystal X-ray diffraction. X-ray diffraction shows that 1 is a cadmium polymer constructed by adipate-bridged dmuclear clusters, and each adipate connects two clusters to form a two-dimen- sional planar structure. Crystal data for 1： monoclinic, space group C2/c, a = 22.403（9）, b = 16.039（6）, c = 13.808（6） A, β= 125.262（6）°, V = 4051（3） A3, Mr = 502.79, Dc = 1.649 g/eraa, μ（MoKa） = 1.114 mm^-1, F（000） = 2016, Z = 8, the final R = 0.0509 and wR = 0.1054 for 1509 observed reflections （I 〉 2σ（I））.
