A new Cd(Ⅱ) complex([Cd(H2PIDC)2]n) with singly deprotonated 2-propyl-imidazole-4,5-dicarboxylate as bridging ligand was synthesized and characterized by X-ray diffraction method.Crystal data:monoclinic,space ...A new Cd(Ⅱ) complex([Cd(H2PIDC)2]n) with singly deprotonated 2-propyl-imidazole-4,5-dicarboxylate as bridging ligand was synthesized and characterized by X-ray diffraction method.Crystal data:monoclinic,space group P21/c,with a=8.2547(11),b=10.7071(15),c=13.9131(14)A,β=126.164(5)o,V=992.8(2)A^3,C16H18N4O8Cd,Mr=506.74,Z=2,Dc=1.695g/cm^3,F(000)=508,μ=1.151 mm^-1,R=0.0296 and wR=0.0812 for 1581 observed reflections.Singly deprotonated ligands(H2PIDC-) act as μ3-bridge and join the Cd(Ⅱ) atoms into a 2-D layer structure.The 2-D layers are further linked by intermolecular hydrogen bonds into a 3D network.The luminescent property of the complex was also investigated.展开更多
Under thermal gradient in solution phase, the reaction of Hg(Ⅱ) and Cd(Ⅱ) salts with 2,3,5,6-tetrakis-(2-pyddyl)pyrazine (tppz) in 1:1 molar ratio afforded dinuclear [{HgI2}2}- tppz)] (1) and mononuclear...Under thermal gradient in solution phase, the reaction of Hg(Ⅱ) and Cd(Ⅱ) salts with 2,3,5,6-tetrakis-(2-pyddyl)pyrazine (tppz) in 1:1 molar ratio afforded dinuclear [{HgI2}2}- tppz)] (1) and mononuclear [CdI2(tppz)] (2) complexes. Single-crystal X-ray diffraction structural analysis reveals that the tppz acts as bis-tridentate and tridentate chelating ligands in 1 and 2, respectively. Metal(Ⅱ) ions adopt a distorted square pyramidal geometry and have the same coor- dination environment in both complexes. Based on the 1H NMR spectroscopy measurements, both complexes decompose in solution and release free tppz.展开更多
Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and...Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and characterized by IR, elemental analyses, thermogravimetric analyses and X-ray diffraction technique. Single-crystal X-ray diffraction analyses revealed that the two complexes both crystallize in the triclinic system, space group P(16)-. For complex 1, the picO ligands adopt a tridentate coordination mode to link copper(Ⅱ) ions into dimmers. PicO ligands also adopt a tridentate mode in complex 2, which connects the cadmium(Ⅱ) to form a one-dimensional chain. Moreover, luminescent properties of 1 and 2 were also investigated.展开更多
A new complex [Cd(H2biim)2(H2O)2]·(ino)2·4H2O (H2biim = 2,2'-biimidazole, ino = isonicotinate-N-oxide) has been prepared and characterized by single-crystal X-ray diffraction analysis, IR and fluore...A new complex [Cd(H2biim)2(H2O)2]·(ino)2·4H2O (H2biim = 2,2'-biimidazole, ino = isonicotinate-N-oxide) has been prepared and characterized by single-crystal X-ray diffraction analysis, IR and fluorescence spectra analysis. The crystal is of triclinic system, space group P1 with a = 7.5380(6), b = 8.0402(7), c = 13.5094(11) , α = 104.269(1), β = 93.604(1), γ = 98.349(1)°, V = 780.93(11) 3, Mr = 765.00, Dc = 1.627 g/cm3, F(000) = 390, μ = 0.776 mm-1 and Z = 1. The final R = 0.0322 and wR = 0.0825 for 7038 observed reflections with I 2σ(I) and R = 0.0341 and wR = 0.0832 for all data. The title complex exhibits an infinite chain-like structure through bridging isonicotinate-N-oxide. Strong interchain hydrogen bonds between isonicotinate-N-oxide and H2biim result in the robust 3-D supramolecular architecture. Moreover, the complex shows strong photoluminescence with emission maximum at λ = 401 nm upon λex = 330 nm.展开更多
The structure of a binuclear cadmium(Ⅱ) quaternary complex, [Cd2(phen)2- Q2(BP)]n 1 (phen = 1,10-phenanthroline, BP = biphenyl-4,4′-dicarboxylic acid, Q = 8-hydroxy- quinoline-anion), has been determined by ...The structure of a binuclear cadmium(Ⅱ) quaternary complex, [Cd2(phen)2- Q2(BP)]n 1 (phen = 1,10-phenanthroline, BP = biphenyl-4,4′-dicarboxylic acid, Q = 8-hydroxy- quinoline-anion), has been determined by X-ray crystallography and characterized by elemental analysis, IR spectrum and thermogravimetric analysis. It crystallizes in the monoclinic system, space group P21/n with a = 13.1906(18), b = 10.9623(15), c = 16.947(2)A, β = 111.3430(10)°, V = 2282.5(5)A^3, Z = 4, Mr = 556.85, Dc = 1.620 g/cm^3, F(000) = 1116,μ= 0.994 mm^-1 and S = 1.056. In the structure, 1D chains are connected via biphenyl-4,4′-dicarboxylic acid, 8-hydroxy quinoline anion and binuclear cadmium atoms into an infinite 1-D molecular chain architecture. Via aryl ring π-π stacking interactions a supramolecular structure is formed in 1.展开更多
The assembly of rigid 1, 4-di(1H-imidazol-4-yl)benzene (L) and Cd(OAc)2·2H2O affords an entangled complex [Cd(L)2(OAc)2]n (1) which was characterized by single-crystal X-ray diffraction, IR, elemental...The assembly of rigid 1, 4-di(1H-imidazol-4-yl)benzene (L) and Cd(OAc)2·2H2O affords an entangled complex [Cd(L)2(OAc)2]n (1) which was characterized by single-crystal X-ray diffraction, IR, elemental analysis and PXRD. The complex crystallizes in monoclinic, space group P21/c with a = 8.2603(9), b = 11.8162(13), c = 14.4138(16), β = 105.309(2)o, V = 1356.9(3)3, Z = 2, C28H26CdN8O4, Mr = 650.97, Dc = 1.593 g/cm3, μ = 0.856 mm?1, S = 1.015, F(000) = 660, the final R = 0.0456 and wR = 0.1366 for 2532 observed reflections (I 2σ(I)). 1 possesses [Cd(L)2]n layer motifs, and parallel sets of layer motifs aggregate into a 2D + 2D → 3D mutually interpenetrated system. Photoluminescence study revealed that complex 1 exhibits strong fluorescent emission bands in the solid state at room temperature.展开更多
Two novel complexes, namely {[Cd(AIP)(4,4'-bpy)]·1.3DMF}n(1) and [Cd(AIP)(2,2'- bpy)]n(2), have been synthesized through solvothermal reaction(H2AIP = 5-aminoisophthalic acid, 2,2'-bpy = 2,2'-bip...Two novel complexes, namely {[Cd(AIP)(4,4'-bpy)]·1.3DMF}n(1) and [Cd(AIP)(2,2'- bpy)]n(2), have been synthesized through solvothermal reaction(H2AIP = 5-aminoisophthalic acid, 2,2'-bpy = 2,2'-bipyridine, 4,4'-bpy = 4,4'-bipyridine, and DMF = N,N'-dimethylformamide) and structurally determined by single-crystal X-ray diffraction. Complex 1 shows a three-dimensional(3D) layer-pillar framework with rectangular channels, while complex 2 displays a two-dimensional(2D) wave net architecture. Furthermore, 1 and 2 were characterized by elemental analysis, infrared spectra(IR), thermal gravimetric analyses(TGA) and fluorescence measurements. The luminescent properties of 1 dispersed in various organic solvents have been investigated systematically, demonstrating high selectivity for acetone via the fluorescence quenching effect.展开更多
By the use of CPB, Cd(Ⅲ) forms a highly sensitive complex with 5-Br-PADAP in aqueous solution, molar absorptivity εis 1. 21 ×105 1. mol-1. cm-1.Trace amount of sulphide can be determined from its effect on the...By the use of CPB, Cd(Ⅲ) forms a highly sensitive complex with 5-Br-PADAP in aqueous solution, molar absorptivity εis 1. 21 ×105 1. mol-1. cm-1.Trace amount of sulphide can be determined from its effect on the complex of Cd (Ⅲ)-5-Br-PADAP-CPB, sulphide in the range 0~3. 2 ×10-6mol dm-3 causes a decrease in absorption, that is a linear function of the concentration, For 13ng cm-3 sulphide, common metal ions such as Na+, K+, Ca2+, Mg2+, Al3+ and anions such as CO (24μg cm-3). S2O (22μg cm-3). PO (20μg cm-3) etc. do not interfere. A method for the indirect determination of sulphide in beer and in dustrial waste water with good selectivity and accuracy is described.展开更多
A novel terpyridine-based complex CdL'S2 (L' = oxide of L; L = 10-hexyl-3-(2,6- di(pyridine-2-yl)pyridine-4-yl)-10H-phenothiazine) has been solvothermally synthesized and characterized by FT-IR spectroscopy, e...A novel terpyridine-based complex CdL'S2 (L' = oxide of L; L = 10-hexyl-3-(2,6- di(pyridine-2-yl)pyridine-4-yl)-10H-phenothiazine) has been solvothermally synthesized and characterized by FT-IR spectroscopy, elemental analysis, 1HNMR and X-ray crystallography. The sulfur of phenothiazine moiety was oxidized when the crystal is formed. The complex C36H37CdN5O2S3 crystallizes in triclinic, space group P1 with a = 9.4452(9), b = 13.0181(14), c = 14.6721(18) A, a = 73.872(1), β = 81.531(1), y = 87.547(2)°, V= 1714.2(3) A3, Mr = 780.29, Dc= 1.512 g.cm-3,μ = 0.861 mm-l, F(000) = 800, Z = 2, the final R = 0.0456 and wR = 0.1059 for I 〉 2σ-(I). The Cd(II) is coordinated by two terminal sulfur ions and three pyridyl nitrogen atoms in a distorted trigonal bipyramidal geometry. Universal hydrogen bonds between the neighboring molecules have generated a supramolecular arrangement which contributes to the stability of the title complex. Fluorescence property and thermogravimetry of the complex have also been investigated and discussed.展开更多
A new Cd(Ⅱ) complex with four nitronyl nitroxide radicals [Cd(NIT4Py)4Cl2](NIT4Py = 2-(4'-pyridinyl)-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide) has been synthesized and structurally characterized by X-ra...A new Cd(Ⅱ) complex with four nitronyl nitroxide radicals [Cd(NIT4Py)4Cl2](NIT4Py = 2-(4'-pyridinyl)-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide) has been synthesized and structurally characterized by X-ray diffraction analysis.It crystallizes in triclinic,space group P1 with a = 7.2441(4),b = 13.6964(8),c = 13.7354(8) ,α = 89.8610(10),β = 77.9180(10),γ = 87.2250(10)°,V = 1331.01(13) 3,C48H64CdCl2N12O8,Mr = 1120.41,Z = 1,Dc = 1.398 g/cm3,μ(MoKα) = 0.573 mm-1,F(000) = 582,S = 1.043,the final R = 0.0257 and wR = 0.0641 for 4333 observed reflections(I 〉2σ(I)).The title complex exists in the mononuclear-metal structures,in which each Cd(Ⅱ) ion adopts a distorted octahedral geometry and is coordinated by two Cl-anions and four pyridyl-N atoms from four NIT4Py ligands.The magnetic measurements show weak antiferromagnetic interactions between the nitroxide radicals.展开更多
基金supported by the National Natural Science Foundation of China (No 20771054)the Foundation of Education Committee of Henan Province (2006150017)
文摘A new Cd(Ⅱ) complex([Cd(H2PIDC)2]n) with singly deprotonated 2-propyl-imidazole-4,5-dicarboxylate as bridging ligand was synthesized and characterized by X-ray diffraction method.Crystal data:monoclinic,space group P21/c,with a=8.2547(11),b=10.7071(15),c=13.9131(14)A,β=126.164(5)o,V=992.8(2)A^3,C16H18N4O8Cd,Mr=506.74,Z=2,Dc=1.695g/cm^3,F(000)=508,μ=1.151 mm^-1,R=0.0296 and wR=0.0812 for 1581 observed reflections.Singly deprotonated ligands(H2PIDC-) act as μ3-bridge and join the Cd(Ⅱ) atoms into a 2-D layer structure.The 2-D layers are further linked by intermolecular hydrogen bonds into a 3D network.The luminescent property of the complex was also investigated.
基金Support of this investigation by the Payame Noor University,Iran is gratefully acknowledged
文摘Under thermal gradient in solution phase, the reaction of Hg(Ⅱ) and Cd(Ⅱ) salts with 2,3,5,6-tetrakis-(2-pyddyl)pyrazine (tppz) in 1:1 molar ratio afforded dinuclear [{HgI2}2}- tppz)] (1) and mononuclear [CdI2(tppz)] (2) complexes. Single-crystal X-ray diffraction structural analysis reveals that the tppz acts as bis-tridentate and tridentate chelating ligands in 1 and 2, respectively. Metal(Ⅱ) ions adopt a distorted square pyramidal geometry and have the same coor- dination environment in both complexes. Based on the 1H NMR spectroscopy measurements, both complexes decompose in solution and release free tppz.
基金financially supported by the National Natural Science Foundation of China(21302003)the Science and Technology Project of Henan Province(No.182102210200)
文摘Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and characterized by IR, elemental analyses, thermogravimetric analyses and X-ray diffraction technique. Single-crystal X-ray diffraction analyses revealed that the two complexes both crystallize in the triclinic system, space group P(16)-. For complex 1, the picO ligands adopt a tridentate coordination mode to link copper(Ⅱ) ions into dimmers. PicO ligands also adopt a tridentate mode in complex 2, which connects the cadmium(Ⅱ) to form a one-dimensional chain. Moreover, luminescent properties of 1 and 2 were also investigated.
基金supported by the National Natural Science Foundation of China (No. 20772042)
文摘A new complex [Cd(H2biim)2(H2O)2]·(ino)2·4H2O (H2biim = 2,2'-biimidazole, ino = isonicotinate-N-oxide) has been prepared and characterized by single-crystal X-ray diffraction analysis, IR and fluorescence spectra analysis. The crystal is of triclinic system, space group P1 with a = 7.5380(6), b = 8.0402(7), c = 13.5094(11) , α = 104.269(1), β = 93.604(1), γ = 98.349(1)°, V = 780.93(11) 3, Mr = 765.00, Dc = 1.627 g/cm3, F(000) = 390, μ = 0.776 mm-1 and Z = 1. The final R = 0.0322 and wR = 0.0825 for 7038 observed reflections with I 2σ(I) and R = 0.0341 and wR = 0.0832 for all data. The title complex exhibits an infinite chain-like structure through bridging isonicotinate-N-oxide. Strong interchain hydrogen bonds between isonicotinate-N-oxide and H2biim result in the robust 3-D supramolecular architecture. Moreover, the complex shows strong photoluminescence with emission maximum at λ = 401 nm upon λex = 330 nm.
基金Siping Sci-tech Development Planning Project(No.2005012)
文摘The structure of a binuclear cadmium(Ⅱ) quaternary complex, [Cd2(phen)2- Q2(BP)]n 1 (phen = 1,10-phenanthroline, BP = biphenyl-4,4′-dicarboxylic acid, Q = 8-hydroxy- quinoline-anion), has been determined by X-ray crystallography and characterized by elemental analysis, IR spectrum and thermogravimetric analysis. It crystallizes in the monoclinic system, space group P21/n with a = 13.1906(18), b = 10.9623(15), c = 16.947(2)A, β = 111.3430(10)°, V = 2282.5(5)A^3, Z = 4, Mr = 556.85, Dc = 1.620 g/cm^3, F(000) = 1116,μ= 0.994 mm^-1 and S = 1.056. In the structure, 1D chains are connected via biphenyl-4,4′-dicarboxylic acid, 8-hydroxy quinoline anion and binuclear cadmium atoms into an infinite 1-D molecular chain architecture. Via aryl ring π-π stacking interactions a supramolecular structure is formed in 1.
基金supported by the Natural Science Foundation of Anhui Provincial Education Commission (No. KJ2011B296 and KJ2009A047ZC)
文摘The assembly of rigid 1, 4-di(1H-imidazol-4-yl)benzene (L) and Cd(OAc)2·2H2O affords an entangled complex [Cd(L)2(OAc)2]n (1) which was characterized by single-crystal X-ray diffraction, IR, elemental analysis and PXRD. The complex crystallizes in monoclinic, space group P21/c with a = 8.2603(9), b = 11.8162(13), c = 14.4138(16), β = 105.309(2)o, V = 1356.9(3)3, Z = 2, C28H26CdN8O4, Mr = 650.97, Dc = 1.593 g/cm3, μ = 0.856 mm?1, S = 1.015, F(000) = 660, the final R = 0.0456 and wR = 0.1366 for 2532 observed reflections (I 2σ(I)). 1 possesses [Cd(L)2]n layer motifs, and parallel sets of layer motifs aggregate into a 2D + 2D → 3D mutually interpenetrated system. Photoluminescence study revealed that complex 1 exhibits strong fluorescent emission bands in the solid state at room temperature.
基金the National Natural Science Foundation of China(21501178)Natural Science Funds of Fujian Province(No.2014H0055)for financial support of this work
文摘Two novel complexes, namely {[Cd(AIP)(4,4'-bpy)]·1.3DMF}n(1) and [Cd(AIP)(2,2'- bpy)]n(2), have been synthesized through solvothermal reaction(H2AIP = 5-aminoisophthalic acid, 2,2'-bpy = 2,2'-bipyridine, 4,4'-bpy = 4,4'-bipyridine, and DMF = N,N'-dimethylformamide) and structurally determined by single-crystal X-ray diffraction. Complex 1 shows a three-dimensional(3D) layer-pillar framework with rectangular channels, while complex 2 displays a two-dimensional(2D) wave net architecture. Furthermore, 1 and 2 were characterized by elemental analysis, infrared spectra(IR), thermal gravimetric analyses(TGA) and fluorescence measurements. The luminescent properties of 1 dispersed in various organic solvents have been investigated systematically, demonstrating high selectivity for acetone via the fluorescence quenching effect.
文摘By the use of CPB, Cd(Ⅲ) forms a highly sensitive complex with 5-Br-PADAP in aqueous solution, molar absorptivity εis 1. 21 ×105 1. mol-1. cm-1.Trace amount of sulphide can be determined from its effect on the complex of Cd (Ⅲ)-5-Br-PADAP-CPB, sulphide in the range 0~3. 2 ×10-6mol dm-3 causes a decrease in absorption, that is a linear function of the concentration, For 13ng cm-3 sulphide, common metal ions such as Na+, K+, Ca2+, Mg2+, Al3+ and anions such as CO (24μg cm-3). S2O (22μg cm-3). PO (20μg cm-3) etc. do not interfere. A method for the indirect determination of sulphide in beer and in dustrial waste water with good selectivity and accuracy is described.
基金Supported by the National Natural Science Foundation of China(201101001,21071001,50873001)the Natural Science FoundationScientific Innovation Team Foundation of Education Department of Anhui Province(KJ2012A025,KJ2010A030,2006KJ007TD)
文摘A novel terpyridine-based complex CdL'S2 (L' = oxide of L; L = 10-hexyl-3-(2,6- di(pyridine-2-yl)pyridine-4-yl)-10H-phenothiazine) has been solvothermally synthesized and characterized by FT-IR spectroscopy, elemental analysis, 1HNMR and X-ray crystallography. The sulfur of phenothiazine moiety was oxidized when the crystal is formed. The complex C36H37CdN5O2S3 crystallizes in triclinic, space group P1 with a = 9.4452(9), b = 13.0181(14), c = 14.6721(18) A, a = 73.872(1), β = 81.531(1), y = 87.547(2)°, V= 1714.2(3) A3, Mr = 780.29, Dc= 1.512 g.cm-3,μ = 0.861 mm-l, F(000) = 800, Z = 2, the final R = 0.0456 and wR = 0.1059 for I 〉 2σ-(I). The Cd(II) is coordinated by two terminal sulfur ions and three pyridyl nitrogen atoms in a distorted trigonal bipyramidal geometry. Universal hydrogen bonds between the neighboring molecules have generated a supramolecular arrangement which contributes to the stability of the title complex. Fluorescence property and thermogravimetry of the complex have also been investigated and discussed.
基金supported by the National Natural Science Foundation of China (No. 20901059 and 20771083)the Technological Development Foundation Project of Tianjin Educational Committee (No. 20080503)
文摘A new Cd(Ⅱ) complex with four nitronyl nitroxide radicals [Cd(NIT4Py)4Cl2](NIT4Py = 2-(4'-pyridinyl)-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide) has been synthesized and structurally characterized by X-ray diffraction analysis.It crystallizes in triclinic,space group P1 with a = 7.2441(4),b = 13.6964(8),c = 13.7354(8) ,α = 89.8610(10),β = 77.9180(10),γ = 87.2250(10)°,V = 1331.01(13) 3,C48H64CdCl2N12O8,Mr = 1120.41,Z = 1,Dc = 1.398 g/cm3,μ(MoKα) = 0.573 mm-1,F(000) = 582,S = 1.043,the final R = 0.0257 and wR = 0.0641 for 4333 observed reflections(I 〉2σ(I)).The title complex exists in the mononuclear-metal structures,in which each Cd(Ⅱ) ion adopts a distorted octahedral geometry and is coordinated by two Cl-anions and four pyridyl-N atoms from four NIT4Py ligands.The magnetic measurements show weak antiferromagnetic interactions between the nitroxide radicals.