The two compounds of [Ln(2-FBA)3·2,2'-bpy ]2(2-FBA = 2-fluorobenzoato, 2,2'-bpy = 2,2'-bipyridine, Ln = Eu(1 ), Dy(2)) were synthesized and their structures were determined by X-ray diffraction method....The two compounds of [Ln(2-FBA)3·2,2'-bpy ]2(2-FBA = 2-fluorobenzoato, 2,2'-bpy = 2,2'-bipyridine, Ln = Eu(1 ), Dy(2)) were synthesized and their structures were determined by X-ray diffraction method. Crystallized complexes 1 and 2 are isomorphous, monoelinie system with P21/n space group. The two complexes are binuclear molecule with an inversion center. The two lanthanide ions are linked by four bridged 2-FBA ligands and each lanthanide ion is further bonded to one chelated bidentate 2-FBA ligand and one 2,2'-bipyridine molecule. The coordination number of metal ion is eight. The europium complex exhibits strong red fluorescence. ^5D0→^7Fj(j = 1 - 4) transition emission of Eu^3+ ion was observed.展开更多
The title complex [ErY(Gly)_6(H_2O)_4](ClO_4)_6 5H_2O has been synthesized.Its crystal structure has been determined by X-ray diffraction method.The crystal is triclinic with space group P1.The unit cell parameters ar...The title complex [ErY(Gly)_6(H_2O)_4](ClO_4)_6 5H_2O has been synthesized.Its crystal structure has been determined by X-ray diffraction method.The crystal is triclinic with space group P1.The unit cell parameters are as follows:a=11.518(4),b=14.105(7),c=15.530(6) ,α=96.61(3), β=102.74(3),γ=105.70(3)°,V=2327.7(17) ~3,Z=2,Dc=2.091g/cm^3.The structure has been refined to a final R of 0.0785.The crystal is an infinite chain complex,in which four carboxyl groups from glycine molecules bridge the Er(Ⅲ)and Y(Ⅲ)ion,other two carboxyl groups bridge two adjacent Er(Ⅲ)or two Y(Ⅲ)ions.展开更多
Two 3D Ln-organic coordination frameworks(Ln = Pr3+ for 1 and Er3+ for 2) have been constructed. Single-crystal X-ray diffraction analysis reveals that the two complexes have similar structures and belong to the m...Two 3D Ln-organic coordination frameworks(Ln = Pr3+ for 1 and Er3+ for 2) have been constructed. Single-crystal X-ray diffraction analysis reveals that the two complexes have similar structures and belong to the monoclinic C2/c space group. The trans-μ4-(η2:η1)-(η1:η1) 1,2-pda2- anions link the LnIII centers to generate a 2D network containing helical motif. The dimensionality is extended into a 3D architecture through cis-bis(μ2-η2:η1) 1,2-pda2- anions linking. The geometry of Ln3+ ions is single-capped anti-square prism. Two complexes were characterized by IR spectra and thermogravimetric analysis. The solid fluorescence of 1 and 2 was also investigated at room temperature.展开更多
Two isostructural lanthanide complexes, [Tb(salen)2]3·3C2H9N2·4CH4O(1) and [Er(salen)2]3·3C2H9N2·2CH4O(2), where H2 salen = N,N'-bis(3-methoxysalicylidene)ethylene-1,2-diamine, have been in sit...Two isostructural lanthanide complexes, [Tb(salen)2]3·3C2H9N2·4CH4O(1) and [Er(salen)2]3·3C2H9N2·2CH4O(2), where H2 salen = N,N'-bis(3-methoxysalicylidene)ethylene-1,2-diamine, have been in situ synthesized under solvothermal conditions and characterized by IR, elemental analysis, powder and single-crystal X-ray diffraction analysis, and magnetic analysis. Single-crystal X-ray diffraction indicates that the complexes crystallize in monoclinic C121 space group. Each lanthanide center is coordinated with four oxygen and four nitrogen atoms from two salen^2- ligands, forming distorted square antiprism geometry. Both 1 and 2 exhibit obvious slow magnetization relaxation under an applied 2 kOe magnetic field.展开更多
The lanthanide Schiff base complex [2-OC6H4CHN(2,6-i-Pr2C6H3)]2ErCl(THF) (C42H52ClErN2O3) has been prepared by the reaction of anhydrous LnCl3 with 2 equiv. of the sodium salt of the bidentate Schiff base N-(2,6-diiso...The lanthanide Schiff base complex [2-OC6H4CHN(2,6-i-Pr2C6H3)]2ErCl(THF) (C42H52ClErN2O3) has been prepared by the reaction of anhydrous LnCl3 with 2 equiv. of the sodium salt of the bidentate Schiff base N-(2,6-diisopropylphenyl)salicylaldimine in THF. The crystal structure was determined by X-ray diffraction analysis. The crystal belongs to triclinic, space group P1 with a = 9.200(1), b = 13.637(2), c = 16.705(2) ? a = 74.493(7), b = 77.979(8), g = 81.306(8), V = 1965.2(4) ?, Z = 2, Mr = 835.60, Dc = 1.412 g/cm3, F(000) = 854, T = 193 K, l(MoKa) = 0.7107 ?and m = 22.38 cm-1. The final R = 0.052 and wR = 0.076 for 8386 observed reflections with I ≥ 2s(I).展开更多
Two new dinuclear lanthanidecomplexes,namely[Ln_(2)(dbm)_(2)(HL)_(2)(CH_(3)OH)_(2)]·4CH_(3)OH[Ln=Tb(1)and Dy(2),Hdbm=dibenzoylmethane]have been synthesized using prepared multidentate Schiff base ligand...Two new dinuclear lanthanidecomplexes,namely[Ln_(2)(dbm)_(2)(HL)_(2)(CH_(3)OH)_(2)]·4CH_(3)OH[Ln=Tb(1)and Dy(2),Hdbm=dibenzoylmethane]have been synthesized using prepared multidentate Schiff base ligand H_(3)L(hydroxy‑acetic acid(4‑diethylamino‑2‑hydroxy‑benzylidene)‑hydrazide)with good biological activity.Structure characterizations show that the complex comprises two Ln3+ions,two dbm-ions,two HL^(2-)ligands,two CH_(3)OH molecules,and four free methanol molecules.Each Ln^(3+)ion is eight‑coordinated.The two central Lnions are bridged by twoμ_(2)‑O atoms leading to a parallelogram[Ln2O2]core.The interaction between the compounds(H_(3)L,1,and 2)and the calf thymus DNA(CT‑DNA)has been further confirmed by UV‑Vis spectrometry,fluorescence titration,and cyclic voltammetry.The results showed that both 1 and 2 could undergo insertion with CT‑DNA.CCDC:2343005,1;2343006,2.展开更多
The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040...The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040(2) , β=104.69(1);, V=3538(1) , Z=2, Dc=2.29 g. cm;, μ=53.2 cm;, F(000)=2384. The asymmetric unit contains two complex motecules and four centre ions. Each erbium (Ⅲ) is coordinated by five oxygen donors from four different glutamates and four oxygen donors from the aqua ligand to form a nine coordination potyhedron. The mean distances of Er—0 (carboxylate) and Er—Ow are 2.439 and 2.41 respectivety. The finat R and Rw are 0.043 and 0. 058, respectivety.展开更多
A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characteriz...A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characterized by single-crystal X-ray diffraction. Crystallographic data: C20H16CuN4O7, Mr= 487.91, triclinic, space group PI, a = 7.8420(2), b = 9.1070(2), c = 15.1140(6) A, a = 76.889(9), β = 81.332(11), γ = 74.844( 11)°, V = 1009.89(5) A^3, Z = 2, Dc = 1.605 g/cm^3, F(000) = 498, μ = 1.134 mm^-1, the final R = 0.0379 and wR = 0.0865 for 2977 observed reflections with 1 〉 2σ(Ⅰ). The Cu(Ⅱ) atom is coordinated by two terminal water molecules, one chelating 1,10-phen molecule and one monodentate 4-cba ligand to form a slightly distorted square pyramid. The title complex molecules are connected through hydrogen bonds and π-π stacking interactions to generate a 2D layered network. The thermogravimetric analysis of the title complex has also been discussed.展开更多
Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTP...Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTPY)(H2O)]n·2nH2O(5), and [Co(HBTC)(PYTPY)(H2O)2](6),(H3BTC = 1,3,5-benzenetricarboxylic acid, PYTPY = 4'-(4-pyridyl)-2,2':6',2''-terpyridine, DMF = N,N?-dimethylformamide), have been synthesized and characterized by elemental analysis, IR and X-ray single-crystal diffraction. Complexes 1~5 all feature one-dimensional chain structures, and complex 6 exhibits a zero-dimensional structure. Complexes 1~5 present three-dimensional(3D) supramolecular frameworks via π-π stacking interactions, whenas 6 has also a 3D supramolecular structure assembled by hydrogen bonding. Meanwhile, complexes 1 ~ 6 exhibit the thermal stabilities and photoluminescent properties.展开更多
A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterize...A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I4 1/α with a = b = 22.5642(19), c = 10.7118(18) A, V = 5453.8(11) A^3, C22H28N4NiO10, Mr= 567.19, Dc = 1.382 g/cm^3, μ(MoKα) = 0.769 mm^-1, F(000) =2368, Z = 8, the final R = 0.0572 and wR = 0.1254 for 1401 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure by mixed ligands of 2-pyridinedicarboxylic acid and 4,4′-pyridine.展开更多
Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-d...Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-dichlorophenylacetic acid (2,4-DCPA), 4-chlorophenylacetic acid (4-DCPA), 4,4"-dipyridyl (4,4"-bipy), 1,3-bis(4-pyridyl)propane(bpp) and AgNO3. Compound 1 crystallizes in monoclinic, space group P21/c with a = 10.035(2), b = 17.796(3), c = 16.448(2) A, fl = 104.086(2)°, V= 2705.9(2) A3, Dc = 1.893 g/cm-3, C28H23C12NsO6Ag2, Mr = 812.15, F(000) = 1608,μ(MoKot) = 1.615 mm-1, Z = 4, R = 0.0310, wR = 0.0832 for 4357 observed reflections (I 〉 20(/)), and R = 0.0362, wR = 0.0873 for all data. Compound 2 crystallizes in monoclinic, space group P21/c with a = 9.840(2), b = 24.971(5), c = 9.3301(2)°, fl = 117.504(2)°, V= 2033.5(7) A3, Dc = 1.666 g/cm3, C2tH19C12N202Ag, Mr = 510.15, F(000) = 1024,/I(MoKa) = 1.273 mml, Z= 4, R = 0.0315 and wR = 0.0680 for 2853 observed reflections (1 〉 20(/)) and R = 0.0454, wR = 0.0736 for all data. Compound 3 crystallizes in monoclinic, space group P21/n with a = 15.472(4), b = 9.000(2), c = 16.262(4) A, fl = 112.049(4)°, V = 2099.0(8) A3, Dc = 1.562 g/cm-3, C2H22C1N203Ag, Mr = 493.73, F(000) = 1000, μ(MoKa) = 1.111 mm-1, Z = 4, R = 0.0296, wR = 0.0821 for 3059 observed reflections (I 〉 2δ-(I)), and R = 0.0398, wR = 0.0986 for all data. The complexes were characterized by elemental analysis, FT-IR, thermogravimetrie analysis (TGA) and X-ray single-crystal structure analysis. Fluorescence properties of complex 3 and PXRD of 1 and 2 have been studied. As a result, in complex 1, the Ag(I) ion is surrounded by two nitrogen atoms from two bipy ligands to form an infinite chain, and adjacent Ag-bipy chains produce "'rungs" of a ladder by silver ions contact. And in complexes 2 and 3, the two-dimensional ,β-sheet like layers are obtained by Ag……Ag interactions.展开更多
A new trinuclear nickel complex,[Ni3(pdc)3(2,2'-bipy)3(H2O)2]·2H2O(H2pdc = pyridine 2,6-dicarboxylic acid,2,2'-bipy = 2,2'-bipyridine) has been hydrothermally synthesized and characterized by IR,elemen...A new trinuclear nickel complex,[Ni3(pdc)3(2,2'-bipy)3(H2O)2]·2H2O(H2pdc = pyridine 2,6-dicarboxylic acid,2,2'-bipy = 2,2'-bipyridine) has been hydrothermally synthesized and characterized by IR,elemental analysis and X-ray diffraction methods.Crystal data for this complex:monoclinic,space group P21/n,a = 21.206(4),b = 10.002(2),c = 28.066(6),β = 108.18(3)°,C51H41N9Ni3O16,Mr = 1212.06,V = 5.656(2) nm3,Dc = 1.423 g·cm-3,μ(MoKα) = 1.062 mm-1,Z = 4,F(000) = 2488,GOOF = 1.034,the final R = 0.0543 and wR = 0.1237 for 6149 observed reflections with Ⅰ 〉 2σ(Ⅰ).In the complex,three nickel(Ⅱ) ions are bridged by the pyridine 2,6-dicarboxylic acid groups,and all nickel(Ⅱ) ions are seven-coordinated by nitrogen atoms of 2,2'-bipyridine and pyridine 2,6-dicarboxylic acid and oxygen atoms from pyridine 2,6-dicarboxylic and water to adopt a severely distorted pentagonal bipyramidal geometry.The emission and excitation peaks of the complex in ethanol solutions are located at 336 and 316 nm,respectively.展开更多
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic...A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.展开更多
A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and s...A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I41/a with a = b = 22.719(2), c = 10.710(2)/k, V = 5527.8(14) A3, C54H46N10Co2O10, Mr= 1112.87, Dc = 1.337 g/cm3,μ(MoKa) = 0.665 mm-1, F(000) = 2296, Z = 4, the final R = 0.0633 and wR = 0.1096 for 1261 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure constructed by mixed ligands of 2-pyridinedicarboxylic acid and 4,4'-bipyridine.展开更多
A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This comple...A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This complex crystallizes in triclinic, space group P1^- with a = 7.3522 (12), b = 7.8376(13), c = 14.898(2) ,A°, a = 84.010(2), β = 86.568(2), γ= 64.586(2)°, V = 771.1(2)A °^3 ,Z = 2, F(000) = 376, Mr = 368.22, D, = 1.586 g/cm^3, g = 0.677 mm ^-1, R = 0.0421 and wR = 0.1253. The vanadium atom of the dioxovanadium (V) is five-coordinated to furnish a distorted trigonal bipyramid geometry.展开更多
A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray dif...A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray diffraction. Complex 1 shows a two-dimensional 3-connected rigid plane. The interactions between the ligand and its complex with DNA were studied by Et Br fluorescence probe. Photoluminescent studies indicate that the complex may be excellent candidates for potential photoactive materials.展开更多
A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by ...A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by X-ray diffraction and further characterized by infrared and elementary analysis. The title complex (C18H18NiN4O10, Mr = 509.07) belongs to the triclinic system, space group P1^- with a = 712490(7), b = 11.0164(10), c = 13.3864(13)A, α = 91.6040(10),β= 98.8620(10), γ= 107.1140(10)°, V= 1006.43(17)A^3, Z = 2, Dc = 1.680 g/cm^3,μ= 1.032 mm^-1, F(000) = 524, the final R = 0.0461 and wR= 0.1238. In the complex, the Ni(H) ion is six-coordinated to assume a distorted octahedral geometry, and a 3D supramolecular network comes into being via weak intermolecular interactions of X-O--.H (X = N, O).展开更多
The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined b...The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined by X-ray single-crystal diffraction. It is of triclinic, space group Pi, with a = 10.958(2), b = 12.311(3), c = 12.556(3) A, α = 81.549(3), β = 82.404(4), γ = 78.348(3)°, Mr = 1049.15, V= 1631.7(6) A3, Z = 1, Dc = 2.135 g/cm^3, F(000) = 980, 2(MoKa) = 0.71073 A,μ(MoKa) = 4.804 mm^-1, the final R = 0.0329 and wR = 0.0723 for 4640 observed reflections with I 〉 2σ(I). The Eu(Ⅲ) ion is eight-coordinated and two Eu(Ⅲ) ions are held together by four 3-iodobenzoate groups in the bidentate bridging mode. The complex was characterized by DTA-TG, IR, UV and fluorescence spectra.展开更多
文摘The two compounds of [Ln(2-FBA)3·2,2'-bpy ]2(2-FBA = 2-fluorobenzoato, 2,2'-bpy = 2,2'-bipyridine, Ln = Eu(1 ), Dy(2)) were synthesized and their structures were determined by X-ray diffraction method. Crystallized complexes 1 and 2 are isomorphous, monoelinie system with P21/n space group. The two complexes are binuclear molecule with an inversion center. The two lanthanide ions are linked by four bridged 2-FBA ligands and each lanthanide ion is further bonded to one chelated bidentate 2-FBA ligand and one 2,2'-bipyridine molecule. The coordination number of metal ion is eight. The europium complex exhibits strong red fluorescence. ^5D0→^7Fj(j = 1 - 4) transition emission of Eu^3+ ion was observed.
基金Project supported by the National Natural Science Foundation of China
文摘The title complex [ErY(Gly)_6(H_2O)_4](ClO_4)_6 5H_2O has been synthesized.Its crystal structure has been determined by X-ray diffraction method.The crystal is triclinic with space group P1.The unit cell parameters are as follows:a=11.518(4),b=14.105(7),c=15.530(6) ,α=96.61(3), β=102.74(3),γ=105.70(3)°,V=2327.7(17) ~3,Z=2,Dc=2.091g/cm^3.The structure has been refined to a final R of 0.0785.The crystal is an infinite chain complex,in which four carboxyl groups from glycine molecules bridge the Er(Ⅲ)and Y(Ⅲ)ion,other two carboxyl groups bridge two adjacent Er(Ⅲ)or two Y(Ⅲ)ions.
基金Supported by the National Natural Science Foundation of China(No.21576112)Natural Science Foundation Project of Jilin Province(No.20130521019JH and 20150623024TC-19)+1 种基金Natural Science Foundation Project of the Education Department of Jilin Province(No.[2014]152)the Science and Technology Development Plan of Siping City(2015049)
文摘Three lanthanide(III) complexes [Ln(4-NCP)(1,4-BDC)]n·xn H2O(Ln = Pr(1), Sm(2), Nd(3). 4-HNCP = 2-(4-carboxyphenyl)imidazo(4,5-f)(1,10)phenanthroline, 1,4-H2 BDC = benzene-1,4-dicarboxylic acid) have been hydrothermally synthesized and characterized via elemental analysis, infrared spectrometry and single-crystal X-ray diffraction. Structural analyses revealed that complexes 1~3 possess similar porous three-dimensional frameworks with the point symbol {4^(12)·6~3}. Meanwhile, complexes 1~3 exhibit excellent thermal stabilities and complex 2 exhibits characteristic luminescent property.
基金supported by the National Natural Science Foundation of China(21373178)the provincial college students’ innovation and entrepreneurship training program(1238)the Natural Science Foundation of Yanan university(YDZ2013-09)
文摘Two 3D Ln-organic coordination frameworks(Ln = Pr3+ for 1 and Er3+ for 2) have been constructed. Single-crystal X-ray diffraction analysis reveals that the two complexes have similar structures and belong to the monoclinic C2/c space group. The trans-μ4-(η2:η1)-(η1:η1) 1,2-pda2- anions link the LnIII centers to generate a 2D network containing helical motif. The dimensionality is extended into a 3D architecture through cis-bis(μ2-η2:η1) 1,2-pda2- anions linking. The geometry of Ln3+ ions is single-capped anti-square prism. Two complexes were characterized by IR spectra and thermogravimetric analysis. The solid fluorescence of 1 and 2 was also investigated at room temperature.
基金supported by the National Natural Science Foundation of China(21101090 and 21561021)
文摘Two isostructural lanthanide complexes, [Tb(salen)2]3·3C2H9N2·4CH4O(1) and [Er(salen)2]3·3C2H9N2·2CH4O(2), where H2 salen = N,N'-bis(3-methoxysalicylidene)ethylene-1,2-diamine, have been in situ synthesized under solvothermal conditions and characterized by IR, elemental analysis, powder and single-crystal X-ray diffraction analysis, and magnetic analysis. Single-crystal X-ray diffraction indicates that the complexes crystallize in monoclinic C121 space group. Each lanthanide center is coordinated with four oxygen and four nitrogen atoms from two salen^2- ligands, forming distorted square antiprism geometry. Both 1 and 2 exhibit obvious slow magnetization relaxation under an applied 2 kOe magnetic field.
文摘The lanthanide Schiff base complex [2-OC6H4CHN(2,6-i-Pr2C6H3)]2ErCl(THF) (C42H52ClErN2O3) has been prepared by the reaction of anhydrous LnCl3 with 2 equiv. of the sodium salt of the bidentate Schiff base N-(2,6-diisopropylphenyl)salicylaldimine in THF. The crystal structure was determined by X-ray diffraction analysis. The crystal belongs to triclinic, space group P1 with a = 9.200(1), b = 13.637(2), c = 16.705(2) ? a = 74.493(7), b = 77.979(8), g = 81.306(8), V = 1965.2(4) ?, Z = 2, Mr = 835.60, Dc = 1.412 g/cm3, F(000) = 854, T = 193 K, l(MoKa) = 0.7107 ?and m = 22.38 cm-1. The final R = 0.052 and wR = 0.076 for 8386 observed reflections with I ≥ 2s(I).
文摘Two new dinuclear lanthanidecomplexes,namely[Ln_(2)(dbm)_(2)(HL)_(2)(CH_(3)OH)_(2)]·4CH_(3)OH[Ln=Tb(1)and Dy(2),Hdbm=dibenzoylmethane]have been synthesized using prepared multidentate Schiff base ligand H_(3)L(hydroxy‑acetic acid(4‑diethylamino‑2‑hydroxy‑benzylidene)‑hydrazide)with good biological activity.Structure characterizations show that the complex comprises two Ln3+ions,two dbm-ions,two HL^(2-)ligands,two CH_(3)OH molecules,and four free methanol molecules.Each Ln^(3+)ion is eight‑coordinated.The two central Lnions are bridged by twoμ_(2)‑O atoms leading to a parallelogram[Ln2O2]core.The interaction between the compounds(H_(3)L,1,and 2)and the calf thymus DNA(CT‑DNA)has been further confirmed by UV‑Vis spectrometry,fluorescence titration,and cyclic voltammetry.The results showed that both 1 and 2 could undergo insertion with CT‑DNA.CCDC:2343005,1;2343006,2.
文摘The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040(2) , β=104.69(1);, V=3538(1) , Z=2, Dc=2.29 g. cm;, μ=53.2 cm;, F(000)=2384. The asymmetric unit contains two complex motecules and four centre ions. Each erbium (Ⅲ) is coordinated by five oxygen donors from four different glutamates and four oxygen donors from the aqua ligand to form a nine coordination potyhedron. The mean distances of Er—0 (carboxylate) and Er—Ow are 2.439 and 2.41 respectivety. The finat R and Rw are 0.043 and 0. 058, respectivety.
基金This work was supported by the NSF for Distinguished Young Scientist of China (20425104) and the NSF of Fujian Province (A0420002, 2005I017)
文摘A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characterized by single-crystal X-ray diffraction. Crystallographic data: C20H16CuN4O7, Mr= 487.91, triclinic, space group PI, a = 7.8420(2), b = 9.1070(2), c = 15.1140(6) A, a = 76.889(9), β = 81.332(11), γ = 74.844( 11)°, V = 1009.89(5) A^3, Z = 2, Dc = 1.605 g/cm^3, F(000) = 498, μ = 1.134 mm^-1, the final R = 0.0379 and wR = 0.0865 for 2977 observed reflections with 1 〉 2σ(Ⅰ). The Cu(Ⅱ) atom is coordinated by two terminal water molecules, one chelating 1,10-phen molecule and one monodentate 4-cba ligand to form a slightly distorted square pyramid. The title complex molecules are connected through hydrogen bonds and π-π stacking interactions to generate a 2D layered network. The thermogravimetric analysis of the title complex has also been discussed.
基金Supported by the National Natural Science Foundation of China(No.21576112)Natural Science Foundation of Jilin Province(20150623024TC-19,20170520147JH)the Science and Technology Development Plan of Siping City(2015049)
文摘Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTPY)(H2O)]n·2nH2O(5), and [Co(HBTC)(PYTPY)(H2O)2](6),(H3BTC = 1,3,5-benzenetricarboxylic acid, PYTPY = 4'-(4-pyridyl)-2,2':6',2''-terpyridine, DMF = N,N?-dimethylformamide), have been synthesized and characterized by elemental analysis, IR and X-ray single-crystal diffraction. Complexes 1~5 all feature one-dimensional chain structures, and complex 6 exhibits a zero-dimensional structure. Complexes 1~5 present three-dimensional(3D) supramolecular frameworks via π-π stacking interactions, whenas 6 has also a 3D supramolecular structure assembled by hydrogen bonding. Meanwhile, complexes 1 ~ 6 exhibit the thermal stabilities and photoluminescent properties.
基金Supported by the Science and Technology Research Projects of the Education Office of Jilin Province (No. 2007. 213)
文摘A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I4 1/α with a = b = 22.5642(19), c = 10.7118(18) A, V = 5453.8(11) A^3, C22H28N4NiO10, Mr= 567.19, Dc = 1.382 g/cm^3, μ(MoKα) = 0.769 mm^-1, F(000) =2368, Z = 8, the final R = 0.0572 and wR = 0.1254 for 1401 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure by mixed ligands of 2-pyridinedicarboxylic acid and 4,4′-pyridine.
基金supported by the Guangdong Science and Technology Department(No.S2012020011054 and 2011B090400415)the Zhanjiang Municipality(No.2011C3108001)projects
文摘Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-dichlorophenylacetic acid (2,4-DCPA), 4-chlorophenylacetic acid (4-DCPA), 4,4"-dipyridyl (4,4"-bipy), 1,3-bis(4-pyridyl)propane(bpp) and AgNO3. Compound 1 crystallizes in monoclinic, space group P21/c with a = 10.035(2), b = 17.796(3), c = 16.448(2) A, fl = 104.086(2)°, V= 2705.9(2) A3, Dc = 1.893 g/cm-3, C28H23C12NsO6Ag2, Mr = 812.15, F(000) = 1608,μ(MoKot) = 1.615 mm-1, Z = 4, R = 0.0310, wR = 0.0832 for 4357 observed reflections (I 〉 20(/)), and R = 0.0362, wR = 0.0873 for all data. Compound 2 crystallizes in monoclinic, space group P21/c with a = 9.840(2), b = 24.971(5), c = 9.3301(2)°, fl = 117.504(2)°, V= 2033.5(7) A3, Dc = 1.666 g/cm3, C2tH19C12N202Ag, Mr = 510.15, F(000) = 1024,/I(MoKa) = 1.273 mml, Z= 4, R = 0.0315 and wR = 0.0680 for 2853 observed reflections (1 〉 20(/)) and R = 0.0454, wR = 0.0736 for all data. Compound 3 crystallizes in monoclinic, space group P21/n with a = 15.472(4), b = 9.000(2), c = 16.262(4) A, fl = 112.049(4)°, V = 2099.0(8) A3, Dc = 1.562 g/cm-3, C2H22C1N203Ag, Mr = 493.73, F(000) = 1000, μ(MoKa) = 1.111 mm-1, Z = 4, R = 0.0296, wR = 0.0821 for 3059 observed reflections (I 〉 2δ-(I)), and R = 0.0398, wR = 0.0986 for all data. The complexes were characterized by elemental analysis, FT-IR, thermogravimetrie analysis (TGA) and X-ray single-crystal structure analysis. Fluorescence properties of complex 3 and PXRD of 1 and 2 have been studied. As a result, in complex 1, the Ag(I) ion is surrounded by two nitrogen atoms from two bipy ligands to form an infinite chain, and adjacent Ag-bipy chains produce "'rungs" of a ladder by silver ions contact. And in complexes 2 and 3, the two-dimensional ,β-sheet like layers are obtained by Ag……Ag interactions.
基金Supported by the Science and Technology Fund of Hengyang Science and Technology Bureau (No. 2008KS035)the Construct Program of the Key Discipline in Hunan Province
文摘A new trinuclear nickel complex,[Ni3(pdc)3(2,2'-bipy)3(H2O)2]·2H2O(H2pdc = pyridine 2,6-dicarboxylic acid,2,2'-bipy = 2,2'-bipyridine) has been hydrothermally synthesized and characterized by IR,elemental analysis and X-ray diffraction methods.Crystal data for this complex:monoclinic,space group P21/n,a = 21.206(4),b = 10.002(2),c = 28.066(6),β = 108.18(3)°,C51H41N9Ni3O16,Mr = 1212.06,V = 5.656(2) nm3,Dc = 1.423 g·cm-3,μ(MoKα) = 1.062 mm-1,Z = 4,F(000) = 2488,GOOF = 1.034,the final R = 0.0543 and wR = 0.1237 for 6149 observed reflections with Ⅰ 〉 2σ(Ⅰ).In the complex,three nickel(Ⅱ) ions are bridged by the pyridine 2,6-dicarboxylic acid groups,and all nickel(Ⅱ) ions are seven-coordinated by nitrogen atoms of 2,2'-bipyridine and pyridine 2,6-dicarboxylic acid and oxygen atoms from pyridine 2,6-dicarboxylic and water to adopt a severely distorted pentagonal bipyramidal geometry.The emission and excitation peaks of the complex in ethanol solutions are located at 336 and 316 nm,respectively.
基金Supported by the Natural Science Foundation of Hunan Province (No. 11JJ9006)Key Project of Science and Technology Plan of Hunan Province (2012FJ2002)+1 种基金Science and Technology Plan of Hunan Province (2012GK3031, 2012WK3029)the Construct Program of Key Discipline in Hunan Province
文摘A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.
基金supported by Science and Technology Research Projects of the Education Office of Jilin Province (No. 2007. 213)
文摘A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I41/a with a = b = 22.719(2), c = 10.710(2)/k, V = 5527.8(14) A3, C54H46N10Co2O10, Mr= 1112.87, Dc = 1.337 g/cm3,μ(MoKa) = 0.665 mm-1, F(000) = 2296, Z = 4, the final R = 0.0633 and wR = 0.1096 for 1261 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure constructed by mixed ligands of 2-pyridinedicarboxylic acid and 4,4'-bipyridine.
基金Project was supported by Scientific Research common program of Beijing municipal commission of education (KM20051028005)
文摘A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This complex crystallizes in triclinic, space group P1^- with a = 7.3522 (12), b = 7.8376(13), c = 14.898(2) ,A°, a = 84.010(2), β = 86.568(2), γ= 64.586(2)°, V = 771.1(2)A °^3 ,Z = 2, F(000) = 376, Mr = 368.22, D, = 1.586 g/cm^3, g = 0.677 mm ^-1, R = 0.0421 and wR = 0.1253. The vanadium atom of the dioxovanadium (V) is five-coordinated to furnish a distorted trigonal bipyramid geometry.
基金supported by the Natural Science Project of Zhejiang Province(LY12B01003)
文摘A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray diffraction. Complex 1 shows a two-dimensional 3-connected rigid plane. The interactions between the ligand and its complex with DNA were studied by Et Br fluorescence probe. Photoluminescent studies indicate that the complex may be excellent candidates for potential photoactive materials.
文摘A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by X-ray diffraction and further characterized by infrared and elementary analysis. The title complex (C18H18NiN4O10, Mr = 509.07) belongs to the triclinic system, space group P1^- with a = 712490(7), b = 11.0164(10), c = 13.3864(13)A, α = 91.6040(10),β= 98.8620(10), γ= 107.1140(10)°, V= 1006.43(17)A^3, Z = 2, Dc = 1.680 g/cm^3,μ= 1.032 mm^-1, F(000) = 524, the final R = 0.0461 and wR= 0.1238. In the complex, the Ni(H) ion is six-coordinated to assume a distorted octahedral geometry, and a 3D supramolecular network comes into being via weak intermolecular interactions of X-O--.H (X = N, O).
基金the Natural Science Foundation of Beijing (No. 2073022) the Young Mainstay Teachers Foundation of Beijing Municipal Universities
文摘The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined by X-ray single-crystal diffraction. It is of triclinic, space group Pi, with a = 10.958(2), b = 12.311(3), c = 12.556(3) A, α = 81.549(3), β = 82.404(4), γ = 78.348(3)°, Mr = 1049.15, V= 1631.7(6) A3, Z = 1, Dc = 2.135 g/cm^3, F(000) = 980, 2(MoKa) = 0.71073 A,μ(MoKa) = 4.804 mm^-1, the final R = 0.0329 and wR = 0.0723 for 4640 observed reflections with I 〉 2σ(I). The Eu(Ⅲ) ion is eight-coordinated and two Eu(Ⅲ) ions are held together by four 3-iodobenzoate groups in the bidentate bridging mode. The complex was characterized by DTA-TG, IR, UV and fluorescence spectra.