The title complex [Sm2（bdc）3（phen）2]n （1, H2bdc = 1,3-benzenedicarboxylic acid, phen = 1,10-phenanthrolin）, a new samarium（III） complex based on ligand H2bdc and 1,10-phen- anthrolin, has been hydrothermally s...The title complex [Sm2（bdc）3（phen）2]n （1, H2bdc = 1,3-benzenedicarboxylic acid, phen = 1,10-phenanthrolin）, a new samarium（III） complex based on ligand H2bdc and 1,10-phen- anthrolin, has been hydrothermally synthesized and characterized by elemental analysis, FT-IR, and single-crystal X-ray diffraction. The crystal structure reveals that the Sm（1） centre adopts an eight-coordinated distorted square anti-prism coordination geometry, while the Sm（2） centre adopts a nine-coordinated distorted monocapped square prism coordination geometry. The ligand bdc2- takes two different connecting modes and links the Sm（llI） centers to give rise to a 2D network structure. Further, 2D layers of 1 are connected together to form a 3D structure through C-H-O hydrogen bonding interactions. The luminescent property and thermal stability of complex 1 are studied. 1 belongs to the triclinic system, space group P1 with a = 10.7367（5）, b = 14.3750（7）, c = 13.7505（3）A, a = 92.8840（10）, β = 104.4010（10）, ）, = 98.1400（10）°, Z= 2, V= 2143.44（18） A3, Mr = 1153.44, Dc = 1.787 g/cm3, F（000） = 1128,μ= 2.784 mm-1, the final R = 0.0279 and wR = 0.0720 for 8226 observed reflections with 1 〉 2σ（I）.展开更多
The binuclear complex Sm2(C12H8N2)2(C6H5COO)6 has been prepared and structurally analyzed by single crystal Xray diffraction. The complex crystallizes in the triclinic system, space group P1 , with a=10.833(2), b=11...The binuclear complex Sm2(C12H8N2)2(C6H5COO)6 has been prepared and structurally analyzed by single crystal Xray diffraction. The complex crystallizes in the triclinic system, space group P1 , with a=10.833(2), b=11.937(2), c=12.448(3) , = 104.97(3), = 93.63(3), = 113.27(3), V=1403.5 3, Dc=1.64g/cm3, =21.42cm-1, F(000)=690, Z=1, final R=0.037, Rw=0.077 for 4855 observed reflections I>2(I) and 5703 independent reflections. In the molecule, each Sm atom is coordinated by seven O atoms and two N atoms forming an irregular coordination polyhedron.展开更多
A novel coordination polymer [Sm（4-Pyta）3（H2O）2]n has been synthesized by the hydrothermal reaction between 4-Pyta （4-Pyta = 4-pyridylthioacetate） and Sm（NO3）3. The structure was characterized by elemental ana...A novel coordination polymer [Sm（4-Pyta）3（H2O）2]n has been synthesized by the hydrothermal reaction between 4-Pyta （4-Pyta = 4-pyridylthioacetate） and Sm（NO3）3. The structure was characterized by elemental analysis, IR spectra and single-crystal X-ray diffraction. The crystal belongs to the triclinic system, space groupP1, with a = 9.100（2）, b = 11.842（3）, c = 12.183（3） A, α= 79.781（4）, β= 74.124（4）, γ = 841882（5）^o, V = 1241.6（5） A^3, Z = 2, Mr = 690.95, Dc = 1.84806 g/cm^3, F（000） = 686,μ = 2.669 mm^-1, the final R = 0.0388 and wR = 0.0808 for 4149 observed reflections with I 〉 2σ（I）. The structural analysis shows that the complex exhibits a one-dimensional architecture. Intermolecular hydrogen bonding interactions are found in the complex molecules.展开更多
基金supported by the Natural Science Foundation of Anhui Province(1208085MB31)NNSFC(21271106)+1 种基金the Applied Chemistry Key Constructing Subject of Anhui Province(200802187C)Student Research Project of Chuzhou University(2012XS18,2012XS19)
文摘The title complex [Sm2（bdc）3（phen）2]n （1, H2bdc = 1,3-benzenedicarboxylic acid, phen = 1,10-phenanthrolin）, a new samarium（III） complex based on ligand H2bdc and 1,10-phen- anthrolin, has been hydrothermally synthesized and characterized by elemental analysis, FT-IR, and single-crystal X-ray diffraction. The crystal structure reveals that the Sm（1） centre adopts an eight-coordinated distorted square anti-prism coordination geometry, while the Sm（2） centre adopts a nine-coordinated distorted monocapped square prism coordination geometry. The ligand bdc2- takes two different connecting modes and links the Sm（llI） centers to give rise to a 2D network structure. Further, 2D layers of 1 are connected together to form a 3D structure through C-H-O hydrogen bonding interactions. The luminescent property and thermal stability of complex 1 are studied. 1 belongs to the triclinic system, space group P1 with a = 10.7367（5）, b = 14.3750（7）, c = 13.7505（3）A, a = 92.8840（10）, β = 104.4010（10）, ）, = 98.1400（10）°, Z= 2, V= 2143.44（18） A3, Mr = 1153.44, Dc = 1.787 g/cm3, F（000） = 1128,μ= 2.784 mm-1, the final R = 0.0279 and wR = 0.0720 for 8226 observed reflections with 1 〉 2σ（I）.
文摘The binuclear complex Sm2(C12H8N2)2(C6H5COO)6 has been prepared and structurally analyzed by single crystal Xray diffraction. The complex crystallizes in the triclinic system, space group P1 , with a=10.833(2), b=11.937(2), c=12.448(3) , = 104.97(3), = 93.63(3), = 113.27(3), V=1403.5 3, Dc=1.64g/cm3, =21.42cm-1, F(000)=690, Z=1, final R=0.037, Rw=0.077 for 4855 observed reflections I>2(I) and 5703 independent reflections. In the molecule, each Sm atom is coordinated by seven O atoms and two N atoms forming an irregular coordination polyhedron.
基金This work was supported by the Education Office of Anhui Province (No. 2003kj255)
文摘A novel coordination polymer [Sm（4-Pyta）3（H2O）2]n has been synthesized by the hydrothermal reaction between 4-Pyta （4-Pyta = 4-pyridylthioacetate） and Sm（NO3）3. The structure was characterized by elemental analysis, IR spectra and single-crystal X-ray diffraction. The crystal belongs to the triclinic system, space groupP1, with a = 9.100（2）, b = 11.842（3）, c = 12.183（3） A, α= 79.781（4）, β= 74.124（4）, γ = 841882（5）^o, V = 1241.6（5） A^3, Z = 2, Mr = 690.95, Dc = 1.84806 g/cm^3, F（000） = 686,μ = 2.669 mm^-1, the final R = 0.0388 and wR = 0.0808 for 4149 observed reflections with I 〉 2σ（I）. The structural analysis shows that the complex exhibits a one-dimensional architecture. Intermolecular hydrogen bonding interactions are found in the complex molecules.
