A new compound formulated [Ag2(idc)](NO3)?H2O (H2idc = iminodiacetic acid) was synthesized under mild conditions and characterized by IR spectrum and single-crystal X-ray diffraction. The crystal crystallizes in the m...A new compound formulated [Ag2(idc)](NO3)?H2O (H2idc = iminodiacetic acid) was synthesized under mild conditions and characterized by IR spectrum and single-crystal X-ray diffraction. The crystal crystallizes in the monoclinic system, space group of P21/n with a = 5.5029(2), b = 11.1316(5), c = 15.5319 (1) ?, β = 96.038(3)o, V = 946.15(6) ?3, Z = 4, R = 0.0619 and wR = 0.1606. Its structure is a 2D polymer, whose repeat units consist of dinuclear silver cluster coordinated by two bridging iminodiacetic acids. In the complex, the Ag(I) ions adopt three coordinate fashions, and the Ag-Ag metal-metal contacts of 2.8418 ? are observed.展开更多
The title complex was synthesized in an aqueous solution at pH=3. 5,and its crystal structure was determined by X-ray diffraction methods. The com-plex is triclinic with space group P1, formula C30H66O42N6Cl6ErY, Mr,=...The title complex was synthesized in an aqueous solution at pH=3. 5,and its crystal structure was determined by X-ray diffraction methods. The com-plex is triclinic with space group P1, formula C30H66O42N6Cl6ErY, Mr,= 1651. 76, a=9. 860(2), b=13. 020(5), c= 13. 632(5) A ; a= 109. 32(3), β=110. 19(2), γ=100. 96(2)°, V= 1456(1 ) A3, Dc= 1. 884 g/cm3, Z= 1, F(000) =833, P= 2. 812mm-1 ;R=0. 046, wR(F2) =0. 123 for 4897 reflections with I>2(I). The complexis of an infinite chain structure with the neibouring metal ions connected by two bridging carboxyl groups from two different proline molecules. The erbium ion and the yttrium ion statistically lies at the position of the metal ion with M=1/2(Er+Y).展开更多
The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040...The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040(2) , β=104.69(1);, V=3538(1) , Z=2, Dc=2.29 g. cm;, μ=53.2 cm;, F(000)=2384. The asymmetric unit contains two complex motecules and four centre ions. Each erbium (Ⅲ) is coordinated by five oxygen donors from four different glutamates and four oxygen donors from the aqua ligand to form a nine coordination potyhedron. The mean distances of Er—0 (carboxylate) and Er—Ow are 2.439 and 2.41 respectivety. The finat R and Rw are 0.043 and 0. 058, respectivety.展开更多
The crystal structure of the title complex salt has been determined by single-crystal X-ray structure analysis. The crystal data are as follows; Monoclinic, P21/c, a=15.6480(10)A,b=16.7870(10)A, c=10.347(2)A, β=90.79...The crystal structure of the title complex salt has been determined by single-crystal X-ray structure analysis. The crystal data are as follows; Monoclinic, P21/c, a=15.6480(10)A,b=16.7870(10)A, c=10.347(2)A, β=90.790(10), V=2717.7(6)A3, Z=3, and R=0.0333 for 4789 unique reflections. The complex anion has a pseudo-octahedral structure distorted more than the CrⅢand CoⅢ analogs, in which cach iminodiacetato ligand (ida2-) is coordinated in a facial fashion with the two N atoms in a cis configuration, resulting in an unsyin-fac structure.展开更多
A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characteriz...A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characterized by single-crystal X-ray diffraction. Crystallographic data: C20H16CuN4O7, Mr= 487.91, triclinic, space group PI, a = 7.8420(2), b = 9.1070(2), c = 15.1140(6) A, a = 76.889(9), β = 81.332(11), γ = 74.844( 11)°, V = 1009.89(5) A^3, Z = 2, Dc = 1.605 g/cm^3, F(000) = 498, μ = 1.134 mm^-1, the final R = 0.0379 and wR = 0.0865 for 2977 observed reflections with 1 〉 2σ(Ⅰ). The Cu(Ⅱ) atom is coordinated by two terminal water molecules, one chelating 1,10-phen molecule and one monodentate 4-cba ligand to form a slightly distorted square pyramid. The title complex molecules are connected through hydrogen bonds and π-π stacking interactions to generate a 2D layered network. The thermogravimetric analysis of the title complex has also been discussed.展开更多
Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTP...Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTPY)(H2O)]n·2nH2O(5), and [Co(HBTC)(PYTPY)(H2O)2](6),(H3BTC = 1,3,5-benzenetricarboxylic acid, PYTPY = 4'-(4-pyridyl)-2,2':6',2''-terpyridine, DMF = N,N?-dimethylformamide), have been synthesized and characterized by elemental analysis, IR and X-ray single-crystal diffraction. Complexes 1~5 all feature one-dimensional chain structures, and complex 6 exhibits a zero-dimensional structure. Complexes 1~5 present three-dimensional(3D) supramolecular frameworks via π-π stacking interactions, whenas 6 has also a 3D supramolecular structure assembled by hydrogen bonding. Meanwhile, complexes 1 ~ 6 exhibit the thermal stabilities and photoluminescent properties.展开更多
A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterize...A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I4 1/α with a = b = 22.5642(19), c = 10.7118(18) A, V = 5453.8(11) A^3, C22H28N4NiO10, Mr= 567.19, Dc = 1.382 g/cm^3, μ(MoKα) = 0.769 mm^-1, F(000) =2368, Z = 8, the final R = 0.0572 and wR = 0.1254 for 1401 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure by mixed ligands of 2-pyridinedicarboxylic acid and 4,4′-pyridine.展开更多
Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-d...Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-dichlorophenylacetic acid (2,4-DCPA), 4-chlorophenylacetic acid (4-DCPA), 4,4"-dipyridyl (4,4"-bipy), 1,3-bis(4-pyridyl)propane(bpp) and AgNO3. Compound 1 crystallizes in monoclinic, space group P21/c with a = 10.035(2), b = 17.796(3), c = 16.448(2) A, fl = 104.086(2)°, V= 2705.9(2) A3, Dc = 1.893 g/cm-3, C28H23C12NsO6Ag2, Mr = 812.15, F(000) = 1608,μ(MoKot) = 1.615 mm-1, Z = 4, R = 0.0310, wR = 0.0832 for 4357 observed reflections (I 〉 20(/)), and R = 0.0362, wR = 0.0873 for all data. Compound 2 crystallizes in monoclinic, space group P21/c with a = 9.840(2), b = 24.971(5), c = 9.3301(2)°, fl = 117.504(2)°, V= 2033.5(7) A3, Dc = 1.666 g/cm3, C2tH19C12N202Ag, Mr = 510.15, F(000) = 1024,/I(MoKa) = 1.273 mml, Z= 4, R = 0.0315 and wR = 0.0680 for 2853 observed reflections (1 〉 20(/)) and R = 0.0454, wR = 0.0736 for all data. Compound 3 crystallizes in monoclinic, space group P21/n with a = 15.472(4), b = 9.000(2), c = 16.262(4) A, fl = 112.049(4)°, V = 2099.0(8) A3, Dc = 1.562 g/cm-3, C2H22C1N203Ag, Mr = 493.73, F(000) = 1000, μ(MoKa) = 1.111 mm-1, Z = 4, R = 0.0296, wR = 0.0821 for 3059 observed reflections (I 〉 2δ-(I)), and R = 0.0398, wR = 0.0986 for all data. The complexes were characterized by elemental analysis, FT-IR, thermogravimetrie analysis (TGA) and X-ray single-crystal structure analysis. Fluorescence properties of complex 3 and PXRD of 1 and 2 have been studied. As a result, in complex 1, the Ag(I) ion is surrounded by two nitrogen atoms from two bipy ligands to form an infinite chain, and adjacent Ag-bipy chains produce "'rungs" of a ladder by silver ions contact. And in complexes 2 and 3, the two-dimensional ,β-sheet like layers are obtained by Ag……Ag interactions.展开更多
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic...A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.展开更多
A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and s...A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I41/a with a = b = 22.719(2), c = 10.710(2)/k, V = 5527.8(14) A3, C54H46N10Co2O10, Mr= 1112.87, Dc = 1.337 g/cm3,μ(MoKa) = 0.665 mm-1, F(000) = 2296, Z = 4, the final R = 0.0633 and wR = 0.1096 for 1261 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure constructed by mixed ligands of 2-pyridinedicarboxylic acid and 4,4'-bipyridine.展开更多
A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This comple...A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This complex crystallizes in triclinic, space group P1^- with a = 7.3522 (12), b = 7.8376(13), c = 14.898(2) ,A°, a = 84.010(2), β = 86.568(2), γ= 64.586(2)°, V = 771.1(2)A °^3 ,Z = 2, F(000) = 376, Mr = 368.22, D, = 1.586 g/cm^3, g = 0.677 mm ^-1, R = 0.0421 and wR = 0.1253. The vanadium atom of the dioxovanadium (V) is five-coordinated to furnish a distorted trigonal bipyramid geometry.展开更多
A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray dif...A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray diffraction. Complex 1 shows a two-dimensional 3-connected rigid plane. The interactions between the ligand and its complex with DNA were studied by Et Br fluorescence probe. Photoluminescent studies indicate that the complex may be excellent candidates for potential photoactive materials.展开更多
A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by ...A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by X-ray diffraction and further characterized by infrared and elementary analysis. The title complex (C18H18NiN4O10, Mr = 509.07) belongs to the triclinic system, space group P1^- with a = 712490(7), b = 11.0164(10), c = 13.3864(13)A, α = 91.6040(10),β= 98.8620(10), γ= 107.1140(10)°, V= 1006.43(17)A^3, Z = 2, Dc = 1.680 g/cm^3,μ= 1.032 mm^-1, F(000) = 524, the final R = 0.0461 and wR= 0.1238. In the complex, the Ni(H) ion is six-coordinated to assume a distorted octahedral geometry, and a 3D supramolecular network comes into being via weak intermolecular interactions of X-O--.H (X = N, O).展开更多
Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and...Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and characterized by IR, elemental analyses, thermogravimetric analyses and X-ray diffraction technique. Single-crystal X-ray diffraction analyses revealed that the two complexes both crystallize in the triclinic system, space group P(16)-. For complex 1, the picO ligands adopt a tridentate coordination mode to link copper(Ⅱ) ions into dimmers. PicO ligands also adopt a tridentate mode in complex 2, which connects the cadmium(Ⅱ) to form a one-dimensional chain. Moreover, luminescent properties of 1 and 2 were also investigated.展开更多
The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined b...The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined by X-ray single-crystal diffraction. It is of triclinic, space group Pi, with a = 10.958(2), b = 12.311(3), c = 12.556(3) A, α = 81.549(3), β = 82.404(4), γ = 78.348(3)°, Mr = 1049.15, V= 1631.7(6) A3, Z = 1, Dc = 2.135 g/cm^3, F(000) = 980, 2(MoKa) = 0.71073 A,μ(MoKa) = 4.804 mm^-1, the final R = 0.0329 and wR = 0.0723 for 4640 observed reflections with I 〉 2σ(I). The Eu(Ⅲ) ion is eight-coordinated and two Eu(Ⅲ) ions are held together by four 3-iodobenzoate groups in the bidentate bridging mode. The complex was characterized by DTA-TG, IR, UV and fluorescence spectra.展开更多
Two novel diethyltin(IV) complexes of N-salicylidenevaline (H2L1) and N-Sali- cylidenetryptophan (H2L^2), Et2SrtL^1 1 and Et2SnL^2 2, were synthesized and characterized by elemental analysis, IR, ^1H NMR and X-r...Two novel diethyltin(IV) complexes of N-salicylidenevaline (H2L1) and N-Sali- cylidenetryptophan (H2L^2), Et2SrtL^1 1 and Et2SnL^2 2, were synthesized and characterized by elemental analysis, IR, ^1H NMR and X-ray single-crystal diffraction analysis. Complex 1 belongs to the trigonal system, space group R-3 with a = b = 19.2730(5), c = 23.6890(13)A^°, V= 7620.4(5) A^°^3, Z = 6, Dc= 1.553 g/cm^3,μ= 1.518 mm^-1, F(000) = 3600, R = 0.0238 and wR = 0.0636. Complex 2 is of monoelinie system, space group P21/c with a = 13.7550(8), b = 11.5425(7), c = 12.7876(7)A^°, β= 93.585(1)°, V = 2026.3(2) A^°^3, Z = 4, Dc= 1.548 g/cm^3,μ = 1.286 mm^-1, F(000) = 976, R = 0.0298 and wR = 0.0722. Complex 1 is a cyclic trimer with a macrocyclic 12-membered ring structure formed by the bidentate bridging coordination of carboxylate group to tin atoms. The tin atom is six-coordinated in a distorted octahedral geometry. In complex 2, the distorted trigonal bipyramidal Et2SnL2 units are linked into polymeric chains by the weak Sn…O interaction involving Sn and the earbonyl O of an adjacent ligand, and the chains are further connected by intermolecular N-H…O hydrogen bonds to form a two-dimensional supramolecular structure.展开更多
A new lanthanum complex, (H3O)2[La(C7H3NO5)2(H2O)212.3(H2O) or (HaO)E[La(HChel)2(HEO)E]2.3(H2O) 1 (H3Chel = 4-hydroxypyridine-2,6-dicarboxylic(chelidamic) acid), has been prepared by the hydrotherm...A new lanthanum complex, (H3O)2[La(C7H3NO5)2(H2O)212.3(H2O) or (HaO)E[La(HChel)2(HEO)E]2.3(H2O) 1 (H3Chel = 4-hydroxypyridine-2,6-dicarboxylic(chelidamic) acid), has been prepared by the hydrothermal reaction, and its crystal structure was determined based on single-crystal diffraction data. Compound I crystallizes in triclinic, space group Pi with a = 9.6939(19), b = 10.176(2), c = 11.502(2)A, α = 111.52(3), β = 93.74(3), γ = 103.33(3)°, V = 1013.0(3)A3, Dc = 1.912 g/cm3, Z = 1, Mr = 1166.40, p = 2.188 mm-1, 2(MoKa) = 0.71073 A and F(000) = 574. The final R = 0.0342 and wR = 0.0737 for 4080 observed reflections with I 〉 2σ(I), and R = 0.0429 and wR = 0.0772 for all data. Compound 1 contains two lanthanum ions, four chelidamic acid ligands, four coordinated water molecules, two hydroniums, and three discrete water molecules. The LaⅢ atom is ten-coordinated by four oxygen and two nitrogen atoms from two tridentate chelating chelidamic acid ligands, two carboxylic oxygen atoms from an adjacent chelidamic acid ligand and two coordinated water molecules, leading to a distorted dodecahedral geometry. A three-dimensional network is formed by H-bonds.展开更多
The title complex Pd(H2BDA)Cl2·2DMSO (C16H14Cl2N2O6PdS2, H2BDA = 2,2'- bipyridine-3,3'-dicarboxylic acid) has been synthesized and characterized by IR spectra, elemental analysis and ^1H NMR spectra. Its st...The title complex Pd(H2BDA)Cl2·2DMSO (C16H14Cl2N2O6PdS2, H2BDA = 2,2'- bipyridine-3,3'-dicarboxylic acid) has been synthesized and characterized by IR spectra, elemental analysis and ^1H NMR spectra. Its structure was determined by single-crystal X-ray diffraction analysis. The complex crystallizes in the monoclinic system, space group P2(1/c) with a = 1.3604(6), b = 1.2606(6), c = 1.3521 (6) nm, β = 103.677(7)°, V = 2.2530(17) nm^3, Mr = 571.75, Z = 4, Dc = 1.686 g/cm^3,μ = 1.280 mm^-1, F(000) = 1136, R= 0.0405 and wR= 0.0908. The complex presents a planar quadrangle arrangement and is assembled via hydrogen bonds.展开更多
A new structure with the molecular formula [CdL]n was formed by CdSO4 with 4-carboxymethoxy phenylacetic acid (H2L) through the hydrothermal method. The complex was characterized by elemental analysis and infrared s...A new structure with the molecular formula [CdL]n was formed by CdSO4 with 4-carboxymethoxy phenylacetic acid (H2L) through the hydrothermal method. The complex was characterized by elemental analysis and infrared spectroscopy. The structure of the complex was determined by single-crystal X-ray diffraction, which is of monoclinic system, space group P21/c with a = 10.3887(2), b = 7.10710(10), c = 14.7212(2) , β = 120.6940(10)°, V = 934.65(3) 3, Dc = 2.278 g·cm-3, Z = 4, F(000) = 624, S = 1.022, the final R = 0.0187 and wR = 0.0487 for 2000 observer reflections (Ⅰ 〉 2σ(Ⅰ)). The center metal ion Cd(Ⅱ) in the complex is six-coordinated in a distorted octahedral geometry, and is connected with L ligands to form a 3D fishing net structure, which is a novel (3,6) network topology. The luminescence of the complex has been investigated, and the result reveals that it displays luminescent property in the voilet region.展开更多
基金This work was supported by the National Natural Science Foundation of China (90206040, 20325106, 20333070), Natural Science Foundation of Fujian Province and the Key Project of the Chinese Academy of Sciences (B982003)
文摘A new compound formulated [Ag2(idc)](NO3)?H2O (H2idc = iminodiacetic acid) was synthesized under mild conditions and characterized by IR spectrum and single-crystal X-ray diffraction. The crystal crystallizes in the monoclinic system, space group of P21/n with a = 5.5029(2), b = 11.1316(5), c = 15.5319 (1) ?, β = 96.038(3)o, V = 946.15(6) ?3, Z = 4, R = 0.0619 and wR = 0.1606. Its structure is a 2D polymer, whose repeat units consist of dinuclear silver cluster coordinated by two bridging iminodiacetic acids. In the complex, the Ag(I) ions adopt three coordinate fashions, and the Ag-Ag metal-metal contacts of 2.8418 ? are observed.
文摘The title complex was synthesized in an aqueous solution at pH=3. 5,and its crystal structure was determined by X-ray diffraction methods. The com-plex is triclinic with space group P1, formula C30H66O42N6Cl6ErY, Mr,= 1651. 76, a=9. 860(2), b=13. 020(5), c= 13. 632(5) A ; a= 109. 32(3), β=110. 19(2), γ=100. 96(2)°, V= 1456(1 ) A3, Dc= 1. 884 g/cm3, Z= 1, F(000) =833, P= 2. 812mm-1 ;R=0. 046, wR(F2) =0. 123 for 4897 reflections with I>2(I). The complexis of an infinite chain structure with the neibouring metal ions connected by two bridging carboxyl groups from two different proline molecules. The erbium ion and the yttrium ion statistically lies at the position of the metal ion with M=1/2(Er+Y).
文摘The crystat structure of {[Er;(L—Glu);(H;O);](ClO;);·3H;O);has been studied by X-ray diffraction. The crystal is monoctinic with space group P2;and cell parameters a=19.987(3) , b=16.505(3) , c=11.040(2) , β=104.69(1);, V=3538(1) , Z=2, Dc=2.29 g. cm;, μ=53.2 cm;, F(000)=2384. The asymmetric unit contains two complex motecules and four centre ions. Each erbium (Ⅲ) is coordinated by five oxygen donors from four different glutamates and four oxygen donors from the aqua ligand to form a nine coordination potyhedron. The mean distances of Er—0 (carboxylate) and Er—Ow are 2.439 and 2.41 respectivety. The finat R and Rw are 0.043 and 0. 058, respectivety.
文摘The crystal structure of the title complex salt has been determined by single-crystal X-ray structure analysis. The crystal data are as follows; Monoclinic, P21/c, a=15.6480(10)A,b=16.7870(10)A, c=10.347(2)A, β=90.790(10), V=2717.7(6)A3, Z=3, and R=0.0333 for 4789 unique reflections. The complex anion has a pseudo-octahedral structure distorted more than the CrⅢand CoⅢ analogs, in which cach iminodiacetato ligand (ida2-) is coordinated in a facial fashion with the two N atoms in a cis configuration, resulting in an unsyin-fac structure.
基金This work was supported by the NSF for Distinguished Young Scientist of China (20425104) and the NSF of Fujian Province (A0420002, 2005I017)
文摘A new Cu(Ⅱ) complex [Cu(4-cba)(1,10-phen)(H2O)2](NO3) (4-Hcba = 4-cyanobenzoic acid) has been synthesized by solvothermal reaction in an ethanol/water mixed solution at 100 ℃ and structurally characterized by single-crystal X-ray diffraction. Crystallographic data: C20H16CuN4O7, Mr= 487.91, triclinic, space group PI, a = 7.8420(2), b = 9.1070(2), c = 15.1140(6) A, a = 76.889(9), β = 81.332(11), γ = 74.844( 11)°, V = 1009.89(5) A^3, Z = 2, Dc = 1.605 g/cm^3, F(000) = 498, μ = 1.134 mm^-1, the final R = 0.0379 and wR = 0.0865 for 2977 observed reflections with 1 〉 2σ(Ⅰ). The Cu(Ⅱ) atom is coordinated by two terminal water molecules, one chelating 1,10-phen molecule and one monodentate 4-cba ligand to form a slightly distorted square pyramid. The title complex molecules are connected through hydrogen bonds and π-π stacking interactions to generate a 2D layered network. The thermogravimetric analysis of the title complex has also been discussed.
基金Supported by the National Natural Science Foundation of China(No.21576112)Natural Science Foundation of Jilin Province(20150623024TC-19,20170520147JH)the Science and Technology Development Plan of Siping City(2015049)
文摘Six new transition metal complexes, [Zn(HBTC)(PYTPY)]n·n PYTPY(1), [Cu(HBTC)(PYTPY)]n·n PYTPY(2), [Co(HBTC)(PYTPY)]n·n DMF(3), [Mn(HBTC)(PYTPY)]n·n DMF(4), [Cd(HBTC)(PYTPY)(H2O)]n·2nH2O(5), and [Co(HBTC)(PYTPY)(H2O)2](6),(H3BTC = 1,3,5-benzenetricarboxylic acid, PYTPY = 4'-(4-pyridyl)-2,2':6',2''-terpyridine, DMF = N,N?-dimethylformamide), have been synthesized and characterized by elemental analysis, IR and X-ray single-crystal diffraction. Complexes 1~5 all feature one-dimensional chain structures, and complex 6 exhibits a zero-dimensional structure. Complexes 1~5 present three-dimensional(3D) supramolecular frameworks via π-π stacking interactions, whenas 6 has also a 3D supramolecular structure assembled by hydrogen bonding. Meanwhile, complexes 1 ~ 6 exhibit the thermal stabilities and photoluminescent properties.
基金Supported by the Science and Technology Research Projects of the Education Office of Jilin Province (No. 2007. 213)
文摘A new metal-organic coordination polymer [Ni[(2-pya)2(4,4′-bipy)]n·6nH2O (2-pya = 2-pyridinecarboxylic acid, 4,4′-bipy = 4,4′-pyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I4 1/α with a = b = 22.5642(19), c = 10.7118(18) A, V = 5453.8(11) A^3, C22H28N4NiO10, Mr= 567.19, Dc = 1.382 g/cm^3, μ(MoKα) = 0.769 mm^-1, F(000) =2368, Z = 8, the final R = 0.0572 and wR = 0.1254 for 1401 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure by mixed ligands of 2-pyridinedicarboxylic acid and 4,4′-pyridine.
基金supported by the Guangdong Science and Technology Department(No.S2012020011054 and 2011B090400415)the Zhanjiang Municipality(No.2011C3108001)projects
文摘Three new coordination polymers {[Ag2(2,4-DCPA)(4,4"-bipy)2(NO3)].(H20)}, (1), [Ag(2,4-DCPA)(bpp)], (2) and {[Ag(4-DCPA)(bpp)]'(H20)}, (3), were synthesized by evaporation methods using 2,4-dichlorophenylacetic acid (2,4-DCPA), 4-chlorophenylacetic acid (4-DCPA), 4,4"-dipyridyl (4,4"-bipy), 1,3-bis(4-pyridyl)propane(bpp) and AgNO3. Compound 1 crystallizes in monoclinic, space group P21/c with a = 10.035(2), b = 17.796(3), c = 16.448(2) A, fl = 104.086(2)°, V= 2705.9(2) A3, Dc = 1.893 g/cm-3, C28H23C12NsO6Ag2, Mr = 812.15, F(000) = 1608,μ(MoKot) = 1.615 mm-1, Z = 4, R = 0.0310, wR = 0.0832 for 4357 observed reflections (I 〉 20(/)), and R = 0.0362, wR = 0.0873 for all data. Compound 2 crystallizes in monoclinic, space group P21/c with a = 9.840(2), b = 24.971(5), c = 9.3301(2)°, fl = 117.504(2)°, V= 2033.5(7) A3, Dc = 1.666 g/cm3, C2tH19C12N202Ag, Mr = 510.15, F(000) = 1024,/I(MoKa) = 1.273 mml, Z= 4, R = 0.0315 and wR = 0.0680 for 2853 observed reflections (1 〉 20(/)) and R = 0.0454, wR = 0.0736 for all data. Compound 3 crystallizes in monoclinic, space group P21/n with a = 15.472(4), b = 9.000(2), c = 16.262(4) A, fl = 112.049(4)°, V = 2099.0(8) A3, Dc = 1.562 g/cm-3, C2H22C1N203Ag, Mr = 493.73, F(000) = 1000, μ(MoKa) = 1.111 mm-1, Z = 4, R = 0.0296, wR = 0.0821 for 3059 observed reflections (I 〉 2δ-(I)), and R = 0.0398, wR = 0.0986 for all data. The complexes were characterized by elemental analysis, FT-IR, thermogravimetrie analysis (TGA) and X-ray single-crystal structure analysis. Fluorescence properties of complex 3 and PXRD of 1 and 2 have been studied. As a result, in complex 1, the Ag(I) ion is surrounded by two nitrogen atoms from two bipy ligands to form an infinite chain, and adjacent Ag-bipy chains produce "'rungs" of a ladder by silver ions contact. And in complexes 2 and 3, the two-dimensional ,β-sheet like layers are obtained by Ag……Ag interactions.
基金Supported by the Natural Science Foundation of Hunan Province (No. 11JJ9006)Key Project of Science and Technology Plan of Hunan Province (2012FJ2002)+1 种基金Science and Technology Plan of Hunan Province (2012GK3031, 2012WK3029)the Construct Program of Key Discipline in Hunan Province
文摘A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.
基金supported by Science and Technology Research Projects of the Education Office of Jilin Province (No. 2007. 213)
文摘A new metal-organic coordination polymer [Co(2-pya)2(4,4'-bipy)]2n-[(4,4'- bipy)0.5· H2O]2n (2-pya = 2-pyridinecarboxylic acid, 4,4'-bipy = 4,4'-bipyridine) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectrum, TG and single-crystal X-ray diffraction. The complex crystallizes in tetragonal, space group I41/a with a = b = 22.719(2), c = 10.710(2)/k, V = 5527.8(14) A3, C54H46N10Co2O10, Mr= 1112.87, Dc = 1.337 g/cm3,μ(MoKa) = 0.665 mm-1, F(000) = 2296, Z = 4, the final R = 0.0633 and wR = 0.1096 for 1261 observed reflections (I 〉 2σ(I)). It exhibits a one-dimensional chain-like structure constructed by mixed ligands of 2-pyridinedicarboxylic acid and 4,4'-bipyridine.
基金Project was supported by Scientific Research common program of Beijing municipal commission of education (KM20051028005)
文摘A new cis-dioxovanadium (V) complex [VO2(C9H8N3O3)](C5H5N) involving a carboxyl group coordination employing a tridentate Schiff Base derived from pyruvic acid and isonicotinyl hydrazide is reported. This complex crystallizes in triclinic, space group P1^- with a = 7.3522 (12), b = 7.8376(13), c = 14.898(2) ,A°, a = 84.010(2), β = 86.568(2), γ= 64.586(2)°, V = 771.1(2)A °^3 ,Z = 2, F(000) = 376, Mr = 368.22, D, = 1.586 g/cm^3, g = 0.677 mm ^-1, R = 0.0421 and wR = 0.1253. The vanadium atom of the dioxovanadium (V) is five-coordinated to furnish a distorted trigonal bipyramid geometry.
基金supported by the Natural Science Project of Zhejiang Province(LY12B01003)
文摘A complex [Cd2Na2(BOABA)2(H2O)8]·H2O(1) was synthesized by using 2,4-bisoxyacetate-benzoic acid(H3BOABA) and Cd(OH)2. It was characterized by elemental analysis, IR spectra, and single-crystal X-ray diffraction. Complex 1 shows a two-dimensional 3-connected rigid plane. The interactions between the ligand and its complex with DNA were studied by Et Br fluorescence probe. Photoluminescent studies indicate that the complex may be excellent candidates for potential photoactive materials.
文摘A novel ternary complex of [NiL1L2·2H2O]·NO3·H2O (L1 = 2-hydroxyl-1,10-phenanthroline (HOphen), L2 = 2-hydroxynicotinic acid (H2nicO)) was synthesized, and its crystal structure was determined by X-ray diffraction and further characterized by infrared and elementary analysis. The title complex (C18H18NiN4O10, Mr = 509.07) belongs to the triclinic system, space group P1^- with a = 712490(7), b = 11.0164(10), c = 13.3864(13)A, α = 91.6040(10),β= 98.8620(10), γ= 107.1140(10)°, V= 1006.43(17)A^3, Z = 2, Dc = 1.680 g/cm^3,μ= 1.032 mm^-1, F(000) = 524, the final R = 0.0461 and wR= 0.1238. In the complex, the Ni(H) ion is six-coordinated to assume a distorted octahedral geometry, and a 3D supramolecular network comes into being via weak intermolecular interactions of X-O--.H (X = N, O).
基金financially supported by the National Natural Science Foundation of China(21302003)the Science and Technology Project of Henan Province(No.182102210200)
文摘Two new complexes based on 6-hydroxypicolinic acid(H_2picO) and 1,10-phenanthroline(phen), such as [Cu_4(picO)_4(phen)_4]·12 H_2O(1) and {[Cd_4(picO)_4(phen)_4(H_2O)_2]·5H_2O}_n(2), have been synthesized and characterized by IR, elemental analyses, thermogravimetric analyses and X-ray diffraction technique. Single-crystal X-ray diffraction analyses revealed that the two complexes both crystallize in the triclinic system, space group P(16)-. For complex 1, the picO ligands adopt a tridentate coordination mode to link copper(Ⅱ) ions into dimmers. PicO ligands also adopt a tridentate mode in complex 2, which connects the cadmium(Ⅱ) to form a one-dimensional chain. Moreover, luminescent properties of 1 and 2 were also investigated.
基金the Natural Science Foundation of Beijing (No. 2073022) the Young Mainstay Teachers Foundation of Beijing Municipal Universities
文摘The complex [Eu(3-IBA)3·2,2'-bipy]2 was synthesized from 3-iodobenzoic acid (3-HIBA), 2,2'-bipyridine (2,2‘-bipy) and EuCl3·6H2O by hydrothermal synthesis, and its crystal structure was determined by X-ray single-crystal diffraction. It is of triclinic, space group Pi, with a = 10.958(2), b = 12.311(3), c = 12.556(3) A, α = 81.549(3), β = 82.404(4), γ = 78.348(3)°, Mr = 1049.15, V= 1631.7(6) A3, Z = 1, Dc = 2.135 g/cm^3, F(000) = 980, 2(MoKa) = 0.71073 A,μ(MoKa) = 4.804 mm^-1, the final R = 0.0329 and wR = 0.0723 for 4640 observed reflections with I 〉 2σ(I). The Eu(Ⅲ) ion is eight-coordinated and two Eu(Ⅲ) ions are held together by four 3-iodobenzoate groups in the bidentate bridging mode. The complex was characterized by DTA-TG, IR, UV and fluorescence spectra.
基金supported by the NNSFC (20701027)the Post-Doctor Innovation Project of Shandong Province (200702021) the Key Laboratory of Colloid Interface Chemistry of Ministry of Education (200707)
文摘Two novel diethyltin(IV) complexes of N-salicylidenevaline (H2L1) and N-Sali- cylidenetryptophan (H2L^2), Et2SrtL^1 1 and Et2SnL^2 2, were synthesized and characterized by elemental analysis, IR, ^1H NMR and X-ray single-crystal diffraction analysis. Complex 1 belongs to the trigonal system, space group R-3 with a = b = 19.2730(5), c = 23.6890(13)A^°, V= 7620.4(5) A^°^3, Z = 6, Dc= 1.553 g/cm^3,μ= 1.518 mm^-1, F(000) = 3600, R = 0.0238 and wR = 0.0636. Complex 2 is of monoelinie system, space group P21/c with a = 13.7550(8), b = 11.5425(7), c = 12.7876(7)A^°, β= 93.585(1)°, V = 2026.3(2) A^°^3, Z = 4, Dc= 1.548 g/cm^3,μ = 1.286 mm^-1, F(000) = 976, R = 0.0298 and wR = 0.0722. Complex 1 is a cyclic trimer with a macrocyclic 12-membered ring structure formed by the bidentate bridging coordination of carboxylate group to tin atoms. The tin atom is six-coordinated in a distorted octahedral geometry. In complex 2, the distorted trigonal bipyramidal Et2SnL2 units are linked into polymeric chains by the weak Sn…O interaction involving Sn and the earbonyl O of an adjacent ligand, and the chains are further connected by intermolecular N-H…O hydrogen bonds to form a two-dimensional supramolecular structure.
基金Supported by the Nanchang Hangkong University Doctoral Foundation (EA200702136)
文摘A new lanthanum complex, (H3O)2[La(C7H3NO5)2(H2O)212.3(H2O) or (HaO)E[La(HChel)2(HEO)E]2.3(H2O) 1 (H3Chel = 4-hydroxypyridine-2,6-dicarboxylic(chelidamic) acid), has been prepared by the hydrothermal reaction, and its crystal structure was determined based on single-crystal diffraction data. Compound I crystallizes in triclinic, space group Pi with a = 9.6939(19), b = 10.176(2), c = 11.502(2)A, α = 111.52(3), β = 93.74(3), γ = 103.33(3)°, V = 1013.0(3)A3, Dc = 1.912 g/cm3, Z = 1, Mr = 1166.40, p = 2.188 mm-1, 2(MoKa) = 0.71073 A and F(000) = 574. The final R = 0.0342 and wR = 0.0737 for 4080 observed reflections with I 〉 2σ(I), and R = 0.0429 and wR = 0.0772 for all data. Compound 1 contains two lanthanum ions, four chelidamic acid ligands, four coordinated water molecules, two hydroniums, and three discrete water molecules. The LaⅢ atom is ten-coordinated by four oxygen and two nitrogen atoms from two tridentate chelating chelidamic acid ligands, two carboxylic oxygen atoms from an adjacent chelidamic acid ligand and two coordinated water molecules, leading to a distorted dodecahedral geometry. A three-dimensional network is formed by H-bonds.
基金This project was supported by the Science Foundation of Shenyang Institute of Chemical Technology, National Science Foundation for Post-doctoral and Corporation Post-doctoral Foundation of Liaoning Province
文摘The title complex Pd(H2BDA)Cl2·2DMSO (C16H14Cl2N2O6PdS2, H2BDA = 2,2'- bipyridine-3,3'-dicarboxylic acid) has been synthesized and characterized by IR spectra, elemental analysis and ^1H NMR spectra. Its structure was determined by single-crystal X-ray diffraction analysis. The complex crystallizes in the monoclinic system, space group P2(1/c) with a = 1.3604(6), b = 1.2606(6), c = 1.3521 (6) nm, β = 103.677(7)°, V = 2.2530(17) nm^3, Mr = 571.75, Z = 4, Dc = 1.686 g/cm^3,μ = 1.280 mm^-1, F(000) = 1136, R= 0.0405 and wR= 0.0908. The complex presents a planar quadrangle arrangement and is assembled via hydrogen bonds.
基金Supported by the Natural Science Foundation of Zhejiang Province (Y12B010003)
文摘A new structure with the molecular formula [CdL]n was formed by CdSO4 with 4-carboxymethoxy phenylacetic acid (H2L) through the hydrothermal method. The complex was characterized by elemental analysis and infrared spectroscopy. The structure of the complex was determined by single-crystal X-ray diffraction, which is of monoclinic system, space group P21/c with a = 10.3887(2), b = 7.10710(10), c = 14.7212(2) , β = 120.6940(10)°, V = 934.65(3) 3, Dc = 2.278 g·cm-3, Z = 4, F(000) = 624, S = 1.022, the final R = 0.0187 and wR = 0.0487 for 2000 observer reflections (Ⅰ 〉 2σ(Ⅰ)). The center metal ion Cd(Ⅱ) in the complex is six-coordinated in a distorted octahedral geometry, and is connected with L ligands to form a 3D fishing net structure, which is a novel (3,6) network topology. The luminescence of the complex has been investigated, and the result reveals that it displays luminescent property in the voilet region.