Two 1-methyl-1H-benzo[d]imidazole derivatives, C_(18)H_(14)CuN_4O_4·C_4H_8O_2(1) and C_9H_9N_3O(2), have been synthesized and characterized by NMR, MS, FT-IR, elementary analysis and X-ray single-crystal ...Two 1-methyl-1H-benzo[d]imidazole derivatives, C_(18)H_(14)CuN_4O_4·C_4H_8O_2(1) and C_9H_9N_3O(2), have been synthesized and characterized by NMR, MS, FT-IR, elementary analysis and X-ray single-crystal diffraction. Compound 1 crystallizes in monoclinic, space group P2_1/n with a = 9.6888(3), b = 7.3772(2), c = 14.3277(4)A, β = 95.819(3)°, V = 1018.81(5) A3, M_r = 501.98, Z = 2, D_c = 1.636 g/cm^3, F(000) = 518, μ = 1.123 mm^(-1), MoKα radiation(λ = 0.71073 A), the final R = 0.0325 and wR = 0.0859 for 1821 observed reflections with I 〉 2σ(I). Compound 2 crystallizes in monoclinic, space group C2/c with a = 14.2908(14), b = 14.4268(13), c = 8.4802(6) A, β = 108.513(9)o, V = 1657.9(3) A3, M_r = 175.19, Z = 8, D_c = 1.404 g/cm^3, F(000) = 736, μ = 0.097 mm^(-1), Mo Kα radiation(λ = 0.71073 A), the final R = 0.0563 and wR = 0.1531 for 1231 observed reflections with I 〉 2σ(I). Intermolecular(N-H···N, N-H···O) and intramolecular(N-H···N, C-H···O) hydrogen bonds, as well as C-H···π and π-π stacking interactions, help to stabilize the crystal structure of compound 2.展开更多
基金Supported by the National Natural Science Foundation of China(No.31370373 and 21102084)Natural Science Foundation of Hubei Province(No.2012FKC14401)
文摘Two 1-methyl-1H-benzo[d]imidazole derivatives, C_(18)H_(14)CuN_4O_4·C_4H_8O_2(1) and C_9H_9N_3O(2), have been synthesized and characterized by NMR, MS, FT-IR, elementary analysis and X-ray single-crystal diffraction. Compound 1 crystallizes in monoclinic, space group P2_1/n with a = 9.6888(3), b = 7.3772(2), c = 14.3277(4)A, β = 95.819(3)°, V = 1018.81(5) A3, M_r = 501.98, Z = 2, D_c = 1.636 g/cm^3, F(000) = 518, μ = 1.123 mm^(-1), MoKα radiation(λ = 0.71073 A), the final R = 0.0325 and wR = 0.0859 for 1821 observed reflections with I 〉 2σ(I). Compound 2 crystallizes in monoclinic, space group C2/c with a = 14.2908(14), b = 14.4268(13), c = 8.4802(6) A, β = 108.513(9)o, V = 1657.9(3) A3, M_r = 175.19, Z = 8, D_c = 1.404 g/cm^3, F(000) = 736, μ = 0.097 mm^(-1), Mo Kα radiation(λ = 0.71073 A), the final R = 0.0563 and wR = 0.1531 for 1231 observed reflections with I 〉 2σ(I). Intermolecular(N-H···N, N-H···O) and intramolecular(N-H···N, C-H···O) hydrogen bonds, as well as C-H···π and π-π stacking interactions, help to stabilize the crystal structure of compound 2.